The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Amino-4-[1-(carboxymethyl-carbamoyl)-2-(2-nitro-benzyloxycarbonylsulfanyl)-ethylcarbamoyl]-butyric acid ID: ALA353372
PubChem CID: 44380766
Max Phase: Preclinical
Molecular Formula: C18H22N4O10S
Molecular Weight: 486.46
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: NC(CCC(=O)NC(CSC(=O)OCc1ccccc1[N+](=O)[O-])C(=O)NCC(=O)O)C(=O)O
Standard InChI: InChI=1S/C18H22N4O10S/c19-11(17(27)28)5-6-14(23)21-12(16(26)20-7-15(24)25)9-33-18(29)32-8-10-3-1-2-4-13(10)22(30)31/h1-4,11-12H,5-9,19H2,(H,20,26)(H,21,23)(H,24,25)(H,27,28)
Standard InChI Key: VAVAZZSGFTUJLL-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 33 0 0 0 0 0 0 0 0999 V2000
4.1375 -3.6667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2667 -1.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2667 -0.3667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4250 -4.0875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4167 -1.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5542 -1.6042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.5875 -3.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5542 -2.4375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9792 0.0458 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7042 -3.6750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8542 -4.0792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1375 -2.8417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7042 -1.1917 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.6917 1.2875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9875 -1.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4167 -2.4375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1292 -1.1917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.5542 0.0458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8708 -4.0917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7042 -2.8500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5875 -2.8500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2750 -2.8500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6917 2.1208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9875 0.8750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8708 -2.4375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1583 -2.8500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3000 -4.0917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.3083 -2.4375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4125 0.8750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4250 -4.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9917 -4.0875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7042 -5.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9917 -4.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 15 1 0
3 2 1 0
4 1 1 0
5 16 1 0
6 2 1 0
7 21 1 0
8 6 1 0
9 3 1 0
10 4 2 0
11 1 1 0
12 1 2 0
13 5 1 0
14 24 1 0
15 13 1 0
16 20 1 0
17 5 2 0
18 3 2 0
19 7 2 0
20 10 1 0
21 25 1 0
22 8 2 0
23 14 2 0
24 9 1 0
25 26 1 0
26 8 1 0
27 7 1 0
28 21 1 0
29 14 1 0
30 4 1 0
31 10 1 0
32 30 2 0
33 32 1 0
33 31 2 0
M CHG 2 1 1 11 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 486.46Molecular Weight (Monoisotopic): 486.1057AlogP: -0.16#Rotatable Bonds: 13Polar Surface Area: 228.26Molecular Species: ZWITTERIONHBA: 10HBD: 5#RO5 Violations: ┄HBA (Lipinski): 14HBD (Lipinski): 6#RO5 Violations (Lipinski): 2CX Acidic pKa: 1.71CX Basic pKa: 9.31CX LogP: -2.85CX LogD: -6.10Aromatic Rings: 1Heavy Atoms: 33QED Weighted: 0.14Np Likeness Score: -0.03
References 1. Bush PE, Norton SJ.. (1985) S-(nitrocarbobenzoxy)glutathiones: potent competitive inhibitors of mammalian glyoxalase II., 28 (6): [PMID:4009606 ] [10.1021/jm00383a025 ]