The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(1R,2S,5S)-N-((2R,3R)-4-amino-1-cyclobutyl-3-hydroxy-4-oxobutan-2-yl)-3-((S)-2-(3-tert-butylureido)-3,3-dimethylbutanoyl)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide ID: ALA3542247
PubChem CID: 118753404
Max Phase: Preclinical
Molecular Formula: C27H47N5O5
Molecular Weight: 521.70
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C)NC(=O)N[C@H](C(=O)N1C[C@H]2[C@@H]([C@H]1C(=O)N[C@H](CC1CCC1)[C@@H](O)C(N)=O)C2(C)C)C(C)(C)C
Standard InChI: InChI=1S/C27H47N5O5/c1-25(2,3)20(30-24(37)31-26(4,5)6)23(36)32-13-15-17(27(15,7)8)18(32)22(35)29-16(19(33)21(28)34)12-14-10-9-11-14/h14-20,33H,9-13H2,1-8H3,(H2,28,34)(H,29,35)(H2,30,31,37)/t15-,16+,17-,18-,19+,20+/m0/s1
Standard InChI Key: FEBWCINGHXXUCV-GNVSMLMZSA-N
Molfile:
RDKit 2D
39 41 0 0 0 0 0 0 0 0999 V2000
31.6645 -8.4806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0788 -7.7672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.2538 -7.7651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9497 -11.7001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6642 -11.2876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3787 -11.7001 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.6642 -10.4626 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
32.3296 -9.9787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9955 -9.9787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0496 -10.3815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0608 -11.2064 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.7583 -9.9593 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.2503 -9.1940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.0752 -9.1961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.7835 -8.7793 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
30.6627 -8.6042 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
30.2353 -11.2876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9497 -12.5250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
30.2353 -10.4626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5208 -11.7001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5169 -10.8709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2353 -12.9375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2353 -13.7625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.5208 -12.5250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.5208 -14.1751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5208 -15.0001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8063 -13.7625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8002 -14.5793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4784 -10.3620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1872 -9.9398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9072 -10.3426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9185 -11.1675 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
36.6160 -9.9204 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.1760 -9.1149 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.4897 -11.1870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0771 -11.7655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0832 -12.5881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9081 -12.5809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.9008 -11.7558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
1 3 1 0
4 5 1 0
5 6 2 0
5 7 1 0
7 8 1 0
8 14 1 0
13 9 1 0
9 7 1 0
8 10 1 1
10 11 2 0
10 12 1 0
14 13 1 0
1 14 1 0
13 1 1 0
14 15 1 1
13 16 1 1
4 17 1 1
4 18 1 0
17 19 1 0
17 20 1 0
17 21 1 0
18 22 1 0
22 23 1 0
22 24 2 0
23 25 1 0
25 26 1 0
25 27 1 0
25 28 1 0
12 29 1 0
29 30 1 0
30 31 1 0
31 32 2 0
31 33 1 0
30 34 1 1
29 35 1 1
35 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
39 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 521.70Molecular Weight (Monoisotopic): 521.3577AlogP: 1.50#Rotatable Bonds: 8Polar Surface Area: 153.86Molecular Species: NEUTRALHBA: 5HBD: 5#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 6#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.54CX Basic pKa: ┄CX LogP: 0.86CX LogD: 0.86Aromatic Rings: ┄Heavy Atoms: 37QED Weighted: 0.33Np Likeness Score: 0.32
References 1. Ghosal A, Yuan Y, Tong W, Su AD, Gu C, Chowdhury SK, Kishnani NS, Alton KB.. (2011) Characterization of human liver enzymes involved in the biotransformation of boceprevir, a hepatitis C virus protease inhibitor., 39 (3): [PMID:21123164 ] [10.1124/dmd.110.036996 ]