The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
16alpha-hydroxy prednisolone ID: ALA3542319
Cas Number: 13951-70-7
PubChem CID: 11047056
Product Number: T302804, Order Now?
Max Phase: Preclinical
Molecular Formula: C21H28O6
Molecular Weight: 376.45
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C[C@]12C=CC(=O)C=C1CC[C@@H]1[C@@H]2[C@@H](O)C[C@@]2(C)[C@H]1C[C@@H](O)[C@]2(O)C(=O)CO
Standard InChI: InChI=1S/C21H28O6/c1-19-6-5-12(23)7-11(19)3-4-13-14-8-16(25)21(27,17(26)10-22)20(14,2)9-15(24)18(13)19/h5-7,13-16,18,22,24-25,27H,3-4,8-10H2,1-2H3/t13-,14-,15-,16+,18+,19-,20-,21-/m0/s1
Standard InChI Key: SEKYBDYVXDAYPY-ILNISADRSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
7.5122 -5.6258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3689 -6.8614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2999 -5.3771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7950 -6.8614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5040 -6.4509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0695 -6.4509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3689 -7.6864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7950 -5.2113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0695 -5.6217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6517 -6.4509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6517 -8.1009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7062 -4.6640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7809 -6.0487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2875 -6.7121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7950 -7.6864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9427 -6.8614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9427 -7.6864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0819 -8.1009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5271 -4.6599 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2296 -8.1009 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.1167 -5.3771 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5040 -4.8008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3689 -5.2113 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3564 -6.0446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2875 -3.9509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6938 -3.2379 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4915 -7.2718 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
6.7867 -6.0446 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
6.0695 -7.2635 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
9.6058 -6.0562 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 6 1 0
3 1 1 0
4 5 1 0
5 1 1 0
6 9 1 0
7 2 1 0
8 1 1 0
9 8 1 0
10 2 1 0
11 7 2 0
3 12 1 1
13 3 1 0
14 5 1 0
15 4 1 0
16 10 2 0
17 16 1 0
18 15 1 0
19 12 2 0
20 17 2 0
21 3 1 0
1 22 1 1
9 23 1 1
2 24 1 1
25 12 1 0
26 25 1 0
5 27 1 6
4 28 1 1
6 29 1 6
14 13 1 0
4 6 1 0
7 18 1 0
11 17 1 0
13 30 1 6
M END Associated Targets(Human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 376.45Molecular Weight (Monoisotopic): 376.1886AlogP: 0.53#Rotatable Bonds: 2Polar Surface Area: 115.06Molecular Species: NEUTRALHBA: 6HBD: 4#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.76CX Basic pKa: ┄CX LogP: 0.20CX LogD: 0.20Aromatic Rings: ┄Heavy Atoms: 27QED Weighted: 0.56Np Likeness Score: 2.54
References 1. Moore CD, Roberts JK, Orton CR, Murai T, Fidler TP, Reilly CA, Ward RM, Yost GS.. (2013) Metabolic pathways of inhaled glucocorticoids by the CYP3A enzymes., 41 (2): [PMID:23143891 ] [10.1124/dmd.112.046318 ]