The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
delta6-budesonide ID: ALA3542373
Cas Number: 109458-75-5
PubChem CID: 91810598
Max Phase: Preclinical
Molecular Formula: C25H32O6
Molecular Weight: 428.53
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCC1O[C@@H]2C[C@H]3[C@@H]4C=CC5=CC(=O)C=C[C@]5(C)[C@H]4[C@@H](O)C[C@]3(C)[C@]2(C(=O)CO)O1
Standard InChI: InChI=1S/C25H32O6/c1-4-5-21-30-20-11-17-16-7-6-14-10-15(27)8-9-23(14,2)22(16)18(28)12-24(17,3)25(20,31-21)19(29)13-26/h6-10,16-18,20-22,26,28H,4-5,11-13H2,1-3H3/t16-,17-,18-,20+,21?,22+,23-,24-,25+/m0/s1
Standard InChI Key: OFBFHEDLHIWDQX-KWVAZRHASA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
10.6207 -8.8282 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
9.2127 -9.6396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1110 -7.3212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8275 -6.9250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2043 -10.4575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5024 -10.8643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1383 -9.4985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3986 -7.7490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3394 -7.5952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3331 -10.0571 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
9.9166 -10.8643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7963 -10.4575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9082 -10.0465 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
12.6188 -8.8282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4026 -6.9419 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.5024 -9.2245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6269 -10.4575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2127 -7.9956 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.5253 -7.3212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1235 -8.1601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9166 -9.2245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9251 -8.4066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6481 -8.0061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0859 -9.3918 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
10.6207 -9.6502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3986 -8.5711 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.8213 -7.7322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0797 -10.8643 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.3437 -8.4172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2021 -8.8176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7963 -9.6396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6104 -7.4898 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.1235 -7.3359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8190 -6.1071 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.3499 -9.2350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27 3 1 0
14 24 1 1
3 8 1 0
21 22 1 0
8 32 1 0
6 12 1 0
31 16 2 0
20 33 1 1
17 25 1 0
11 17 2 0
29 9 1 1
5 11 1 0
19 27 1 0
20 32 1 0
35 10 1 6
21 13 1 6
29 20 1 0
22 18 1 1
6 5 2 0
25 35 1 0
34 4 1 0
16 2 1 0
28 12 2 0
22 23 1 0
14 20 1 0
5 2 1 0
35 7 1 0
25 1 1 1
15 33 2 0
23 29 1 0
2 21 1 0
35 29 1 0
4 33 1 0
26 8 1 0
2 30 1 1
12 31 1 0
7 14 1 0
25 21 1 0
14 26 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 428.53Molecular Weight (Monoisotopic): 428.2199AlogP: 2.49#Rotatable Bonds: 4Polar Surface Area: 93.06Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.75CX Basic pKa: ┄CX LogP: 2.37CX LogD: 2.37Aromatic Rings: ┄Heavy Atoms: 31QED Weighted: 0.71Np Likeness Score: 2.46
References 1. Moore CD, Roberts JK, Orton CR, Murai T, Fidler TP, Reilly CA, Ward RM, Yost GS.. (2013) Metabolic pathways of inhaled glucocorticoids by the CYP3A enzymes., 41 (2): [PMID:23143891 ] [10.1124/dmd.112.046318 ]