The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
finasteride-omega-oic acid ID: ALA3542374
Cas Number: 116285-37-1
PubChem CID: 18632991
Product Number: F334440, Order Now?
Max Phase: Preclinical
Molecular Formula: C23H34N2O4
Molecular Weight: 402.54
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(NC(=O)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4NC(=O)C=C[C@]4(C)[C@H]3CC[C@]12C)C(=O)O
Standard InChI: InChI=1S/C23H34N2O4/c1-21(2,20(28)29)25-19(27)16-7-6-14-13-5-8-17-23(4,12-10-18(26)24-17)15(13)9-11-22(14,16)3/h10,12-17H,5-9,11H2,1-4H3,(H,24,26)(H,25,27)(H,28,29)/t13-,14-,15-,16+,17+,22-,23+/m0/s1
Standard InChI Key: OFTBMAPJHKDDJV-MKMSXTRJSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
13.3929 -10.2809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2632 -11.4943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3805 -11.0981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9690 -11.0857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6747 -11.4985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1729 -9.2202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1729 -10.0374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5575 -12.7119 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.5575 -11.0775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2508 -12.3115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8517 -12.3115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4671 -8.8116 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.6954 -9.8517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9690 -10.2603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1605 -11.3623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8517 -11.4943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6434 -10.7060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6747 -12.3115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8745 -8.8075 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9566 -12.7201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4548 -8.0027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1418 -12.7201 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.3929 -9.4555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2508 -10.6771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1605 -7.5941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4548 -7.1896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7573 -7.5982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6623 -10.6813 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
13.3805 -11.9071 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
11.2467 -13.1205 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
11.9566 -11.9029 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
14.1625 -6.7810 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.7471 -6.7810 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 4 1 0
3 1 1 0
4 14 1 0
5 3 1 0
7 6 1 1
7 1 1 0
8 10 1 0
9 2 1 0
10 2 1 0
11 8 1 0
12 6 1 0
13 1 1 0
14 13 1 0
15 3 1 0
16 9 2 0
17 7 1 0
18 5 1 0
19 6 2 0
20 18 1 0
21 12 1 0
22 11 2 0
1 23 1 1
2 24 1 1
25 21 1 0
26 21 1 0
27 21 1 0
5 28 1 1
3 29 1 6
10 30 1 6
4 31 1 6
17 15 1 0
5 4 1 0
20 10 1 0
11 16 1 0
26 32 1 0
26 33 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 402.54Molecular Weight (Monoisotopic): 402.2519AlogP: 2.88#Rotatable Bonds: 3Polar Surface Area: 95.50Molecular Species: ACIDHBA: 3HBD: 3#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.04CX Basic pKa: 0.16CX LogP: 2.50CX LogD: -0.64Aromatic Rings: ┄Heavy Atoms: 29QED Weighted: 0.68Np Likeness Score: 1.80
References 1. Lundahl A, Hedeland M, Bondesson U, Lennernäs H.. (2011) In vivo investigation in pigs of intestinal absorption, hepatobiliary disposition, and metabolism of the 5α-reductase inhibitor finasteride and the effects of coadministered ketoconazole., 39 (5): [PMID:21317368 ] [10.1124/dmd.110.035311 ]