The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
[14C]-1-piperidinecarboxamide,4-(4-acetyl-1-piperazinyl)-N-((1R)-1-(3,5-bis(trifluoromethyl)phenyl)-ethyl)-2-(4-fluoro-2-methylphenyl)-N-methyl-(2R,4S)mesylate ID: ALA3542382
PubChem CID: 118753491
Max Phase: Preclinical
Molecular Formula: C31H39F7N4O5S
Molecular Weight: 616.62
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)N1CCN([C@H]2CCN([14C](=O)N(C)[C@H](C)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)[C@@H](c3ccc(F)cc3C)C2)CC1.CS(=O)(=O)O
Standard InChI: InChI=1S/C30H35F7N4O2.CH4O3S/c1-18-13-24(31)5-6-26(18)27-17-25(40-11-9-39(10-12-40)20(3)42)7-8-41(27)28(43)38(4)19(2)21-14-22(29(32,33)34)16-23(15-21)30(35,36)37;1-5(2,3)4/h5-6,13-16,19,25,27H,7-12,17H2,1-4H3;1H3,(H,2,3,4)/t19-,25+,27-;/m1./s1/i28+2;
Standard InChI Key: YRFKYVWDPCOSTE-MYLQGMGMSA-N
Molfile:
RDKit 2D
48 50 0 0 0 0 0 0 0 0999 V2000
10.6478 -10.9632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3556 -10.5546 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
12.0633 -10.9632 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7717 -9.9685 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.7581 -9.8406 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3025 -7.8458 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5865 -8.2559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8726 -7.8423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8746 -7.0183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5906 -6.6081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3045 -7.0219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0121 -8.2595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0101 -9.0834 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7281 -7.8493 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7301 -7.0254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5844 -9.0798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8686 -9.4900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8665 -10.3139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5804 -10.7276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2963 -10.3174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2983 -9.4935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1547 -9.0763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5784 -11.5470 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.4378 -8.2630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4357 -9.0869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1538 -7.8527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1558 -7.0289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8717 -6.6187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5814 -7.0324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5794 -7.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8676 -8.2665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2933 -8.2700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0072 -8.6837 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.3758 -9.0625 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.1204 -7.8869 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.8737 -5.7948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5735 -5.3007 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.8758 -4.9709 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.0912 -5.3380 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.1607 -6.6046 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4490 -7.0148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7351 -6.6010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7371 -5.7772 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.4531 -5.3670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1627 -5.7807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0273 -5.3635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0295 -4.5396 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3114 -5.7737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 2 0
2 5 2 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
6 11 1 0
12 13 2 0
12 14 1 0
6 12 1 0
14 15 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
16 21 2 0
17 22 1 0
19 23 1 0
7 16 1 1
24 25 1 1
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
26 31 2 0
32 33 1 0
32 34 1 0
32 35 1 0
30 32 1 0
36 37 1 0
36 38 1 0
36 39 1 0
28 36 1 0
24 26 1 0
14 24 1 0
40 41 1 0
41 42 1 0
42 43 1 0
43 44 1 0
44 45 1 0
40 45 1 0
46 47 2 0
46 48 1 0
43 46 1 0
9 40 1 1
M ISO 1 12 14
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 616.62Molecular Weight (Monoisotopic): 616.2648AlogP: 6.65#Rotatable Bonds: 4Polar Surface Area: 47.10Molecular Species: NEUTRALHBA: 3HBD: ┄#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 7.31CX LogP: 4.97CX LogD: 4.71Aromatic Rings: 2Heavy Atoms: 43QED Weighted: 0.36Np Likeness Score: -0.99
References 1. Pagliarusco S, Martinucci S, Bordini E, Miraglia L, Cufari D, Ferrari L, Pellegatti M.. (2011) Tissue distribution and characterization of drug-related material in rats and dogs after repeated oral administration of casopitant., 39 (2): [PMID:20978104 ] [10.1124/dmd.110.035063 ]