[3-(3-Methyl-2-pyridin-2-ylmethyl-benzofuran-4-yloxy)-propyl]-pyridin-3-ylmethyl-amine

ID: ALA355170

PubChem CID: 44382881

Max Phase: Preclinical

Molecular Formula: C24H25N3O2

Molecular Weight: 387.48

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1c(Cc2ccccn2)oc2cccc(OCCCNCc3cccnc3)c12

Standard InChI:  InChI=1S/C24H25N3O2/c1-18-23(15-20-8-2-3-13-27-20)29-22-10-4-9-21(24(18)22)28-14-6-12-26-17-19-7-5-11-25-16-19/h2-5,7-11,13,16,26H,6,12,14-15,17H2,1H3

Standard InChI Key:  OXVBSWQZKXZPIP-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
    3.4167   -0.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9292    0.3708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1417    0.1125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9292   -0.9667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1417   -0.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2417   -0.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4292    0.5250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2375   -1.7250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.9875    2.6000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6542   -1.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5667    2.5958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1792    1.1583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1292    2.5875    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4292   -1.1292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4250    1.3500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2667    3.0083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7042    2.5833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8500    3.0083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7167   -0.7167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7167    0.1125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6500   -2.4375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9917    1.7708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4167    3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7125    1.7583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5625    1.7708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4750   -1.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2792    1.3583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4750   -2.4375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8875   -1.7167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  1  1  0
  5  4  1  0
  6  1  1  0
  7  3  2  0
  8 10  2  0
  9 16  2  0
 10  6  1  0
 11 18  1  0
 12  2  1  0
 13 23  1  0
 14  5  2  0
 15  7  1  0
 16 11  1  0
 17 24  1  0
 18 13  1  0
 19 14  1  0
 20  7  1  0
 21  8  1  0
 22 27  2  0
 23 17  1  0
 24 15  1  0
 25 11  2  0
 26 10  1  0
 27 25  1  0
 28 29  1  0
 29 26  2  0
  3  5  1  0
 20 19  2  0
 21 28  2  0
  9 22  1  0
M  END

Associated Targets(Human)

NMT1 Tchem Peptide N-myristoyltransferase (241 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 387.48Molecular Weight (Monoisotopic): 387.1947AlogP: 4.68#Rotatable Bonds: 9
Polar Surface Area: 60.18Molecular Species: BASEHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.80CX LogP: 3.36CX LogD: 1.95
Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.42Np Likeness Score: -0.84

References

1. Kawasaki K, Masubuchi M, Morikami K, Sogabe S, Aoyama T, Ebiike H, Niizuma S, Hayase M, Fujii T, Sakata K, Shindoh H, Shiratori Y, Aoki Y, Ohtsuka T, Shimma N..  (2003)  Design and synthesis of novel benzofurans as a new class of antifungal agents targeting fungal N-myristoyltransferase. Part 3.,  13  (1): [PMID:12467623] [10.1016/s0960-894x(02)00844-2]

Source