(S)-2-((S)-4-Carboxy-4-{4-[(2-methyl-4-oxo-3,4-dihydro-quinazolin-6-ylmethyl)-prop-2-ynyl-amino]-benzoylamino}-butyrylamino)-pentanedioic acid

ID: ALA355543

PubChem CID: 136074349

Max Phase: Preclinical

Molecular Formula: C30H31N5O9

Molecular Weight: 605.60

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  C#CCN(Cc1ccc2nc(C)nc(O)c2c1)c1ccc(C(=O)N[C@@H](CCC(=O)N[C@@H](CCC(=O)O)C(=O)O)C(=O)O)cc1

Standard InChI:  InChI=1S/C30H31N5O9/c1-3-14-35(16-18-4-9-22-21(15-18)28(40)32-17(2)31-22)20-7-5-19(6-8-20)27(39)34-24(30(43)44)10-12-25(36)33-23(29(41)42)11-13-26(37)38/h1,4-9,15,23-24H,10-14,16H2,2H3,(H,33,36)(H,34,39)(H,37,38)(H,41,42)(H,43,44)(H,31,32,40)/t23-,24-/m0/s1

Standard InChI Key:  CTVPMDSEKDRELN-ZEQRLZLVSA-N

Molfile:  

     RDKit          2D

 44 46  0  0  1  0  0  0  0  0999 V2000
    0.4125   -5.7292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1375   -6.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3000   -6.1417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4125   -7.3917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1375   -6.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3000   -6.9750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8625   -4.4417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5875   -4.8542    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1625   -6.0667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4750   -2.5292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3500   -3.2542    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0125   -6.1250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7250   -7.3667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3250   -5.2750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0500   -4.0167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4375   -7.7792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6417   -2.5042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8500   -5.7250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1500   -4.8750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0500   -0.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7250   -5.7042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4125   -4.9000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2875   -5.7167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8625   -3.6167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5750   -6.1292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8500   -6.4917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.7750   -1.7667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8625   -7.3875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5750   -4.6792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.3917    0.3500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4250   -4.4625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1500   -5.7042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4375   -6.1167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7125   -4.8792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0625   -4.9375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1750   -1.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2375   -4.1292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5167   -1.0750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0125   -6.9542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9375   -3.2167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4000   -6.4000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5750   -6.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2292   -0.4667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0125   -7.3917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  1  2  0
  4  6  2  0
  5  2  2  0
  6  3  1  0
  7 19  1  0
  8  7  1  0
  9 14  1  0
 10 17  1  0
 11 15  1  0
 12 23  1  0
 13 39  1  0
 14  8  1  0
 15 37  1  0
 16 13  3  0
 17 11  1  0
 18  2  1  0
 19 31  1  0
 20 38  1  0
 21 12  1  0
 22  1  1  0
 23 25  1  0
 24  7  2  0
 25 18  2  0
 26  9  2  0
 27 10  2  0
 28  5  1  0
 29 15  2  0
 30 20  2  0
 31 34  2  0
 32 33  1  0
 33 21  2  0
 34 21  1  0
 14 35  1  1
 17 36  1  1
 37 35  1  0
 38 36  1  0
 39 12  1  0
 40 10  1  0
 41  9  1  0
 42 25  1  0
 43 20  1  0
 44  6  1  0
  4  5  1  0
 28 42  2  0
 32 19  2  0
M  END

Alternative Forms

1. Alternative Forms:

   

   ALA355543

   ---

2. Parent:

   

   ALA355543

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 605.60

Molecular Weight (Monoisotopic): 605.2122

AlogP: 1.68

#Rotatable Bonds: 15

Polar Surface Area: 219.35

Molecular Species: ACID

HBA: 9

HBD: 6

#RO5 Violations: 2

HBA (Lipinski): 14

HBD (Lipinski): 6

#RO5 Violations (Lipinski): 3

CX Acidic pKa: 3.06

CX Basic pKa: 1.74

CX LogP: 2.04

CX LogD: -7.64

Aromatic Rings: 3

Heavy Atoms: 44

QED Weighted: 0.14

Np Likeness Score: -0.78

References

1. Bavetsias V, Jackman AL, Kimbell R, Gibson W, Boyle FT, Bisset GM..  (1996)  Quinazoline antifolate thymidylate synthase inhibitors: gamma-linked L-D, D-D, and D-L dipeptide analogues of 2-desamino-2-methyl-N10-propargyl-5,8-dideazafolic acid (ICI 198583).,  39  (1): [PMID:8568829] [10.1021/jm950471+]

2. Bisset GM, Pawelczak K, Jackman AL, Calvert AH, Hughes LR..  (1992)  Syntheses and thymidylate synthase inhibitory activity of the poly-gamma-glutamyl conjugates of N-[5-[N-(3,4-dihydro-2-methyl-4-oxoquinazolin-6-ylmethyl)-N-methylamino ]-2-thenoyl]-L-glutamic acid (ICI D1694) and other quinazoline antifolates.,  35  (5): [PMID:1372358] [10.1021/jm00083a008]

Source

Source(1):

• Scientific Literature