The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-{5-[(E)-2-((6S,7S)-7-{2-(2-Amino-thiazol-4-yl)-2-[(E)-methoxyimino]-acetylamino}-2-carboxy-8-oxo-4-thia-1-aza-bicyclo[4.2.0]oct-2-en-3-yl)-vinyl]-furan-2-ylmethyl}-pyridinium ID: ALA3559428
PubChem CID: 118753752
Max Phase: Preclinical
Molecular Formula: C25H22N6O6S2
Molecular Weight: 566.62
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CO/N=C(/C(=O)N[C@@H]1C(=O)N2C(C(=O)[O-])=C(/C=C/c3ccc(C[n+]4ccccc4)o3)SC[C@H]12)c1csc(N)n1
Standard InChI: InChI=1S/C25H22N6O6S2/c1-36-29-19(16-12-39-25(26)27-16)22(32)28-20-17-13-38-18(21(24(34)35)31(17)23(20)33)8-7-14-5-6-15(37-14)11-30-9-3-2-4-10-30/h2-10,12,17,20H,11,13H2,1H3,(H3-,26,27,28,32,34,35)/b8-7+,29-19+/t17-,20+/m1/s1
Standard InChI Key: APIGEWVKOBSGIO-VCTKVYEWSA-N
Molfile:
RDKit 2D
40 44 0 0 1 0 0 0 0 0999 V2000
4.5750 -3.7250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.7542 -2.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7542 -3.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2792 -4.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5792 -2.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8917 -2.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6042 -2.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8375 -3.7250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.0375 -2.4917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.3167 -2.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9917 -3.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0417 -3.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0000 -2.9125 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.2750 -4.9625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7417 -5.0292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.1167 -2.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4083 -3.2375 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.2917 -2.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4417 -4.4417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8917 -3.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7042 -4.1500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1292 -4.1625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4250 -3.7417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6042 -1.6625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.1750 -4.3167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0167 -5.1542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2167 -4.9792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2625 -4.3625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3167 -3.7250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5542 -5.3667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2625 -4.7042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9875 -5.3792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8917 -1.2500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3917 -5.7792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5542 -4.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8917 -0.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0375 -5.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8750 -6.4542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7000 -6.3667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3198 -1.9384 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2 5 1 0
3 1 1 0
4 1 1 0
5 1 1 0
6 7 1 0
7 10 1 0
8 6 1 0
2 9 1 1
10 9 1 0
11 4 2 0
12 8 2 0
13 18 1 0
14 4 1 0
15 28 1 0
16 6 2 0
17 16 1 0
5 18 1 0
19 20 1 0
20 22 1 0
21 11 1 0
22 23 1 0
23 21 2 0
24 7 2 0
25 3 2 0
26 27 1 0
27 22 2 0
28 19 1 0
29 10 2 0
30 14 2 0
31 12 1 0
32 14 1 0
33 24 1 0
34 15 2 0
35 15 1 0
36 33 1 0
37 35 2 0
38 34 1 0
39 37 1 0
3 2 1 0
11 13 1 0
26 19 2 0
17 12 1 0
38 39 2 0
5 40 1 6
M CHG 2 15 1 32 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 566.62Molecular Weight (Monoisotopic): 566.1042AlogP: 0.12#Rotatable Bonds: 9Polar Surface Area: 167.06Molecular Species: ACIDHBA: 11HBD: 2#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 2.92CX Basic pKa: 3.53CX LogP: -3.67CX LogD: -3.34Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.16Np Likeness Score: -0.31
References 1. Aszodi J, Bonnet A, Chantot J, Costerousse G, Didierlaurent S, Teutsch G. (1993) Vinylogous vs arylogous isocephems, 3 (11): [10.1016/S0960-894X(01)80930-6 ]