The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-{3-[(E)-2-((6S,7S)-7-{2-(2-Amino-thiazol-4-yl)-2-[(E)-methoxyimino]-acetylamino}-2-carboxy-8-oxo-4-thia-1-aza-bicyclo[4.2.0]oct-2-en-3-yl)-vinyl]-benzyl}-pyridinium ID: ALA3559432
PubChem CID: 118753756
Max Phase: Preclinical
Molecular Formula: C27H24N6O5S2
Molecular Weight: 576.66
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CO/N=C(/C(=O)N[C@@H]1C(=O)N2C(C(=O)[O-])=C(/C=C/c3cccc(C[n+]4ccccc4)c3)SC[C@H]12)c1csc(N)n1
Standard InChI: InChI=1S/C27H24N6O5S2/c1-38-31-21(18-14-40-27(28)29-18)24(34)30-22-19-15-39-20(23(26(36)37)33(19)25(22)35)9-8-16-6-5-7-17(12-16)13-32-10-3-2-4-11-32/h2-12,14,19,22H,13,15H2,1H3,(H3-,28,29,30,34,36,37)/b9-8+,31-21+/t19-,22+/m1/s1
Standard InChI Key: YREYAITURYEAMQ-LLBLETOXSA-N
Molfile:
RDKit 2D
41 45 0 0 1 0 0 0 0 0999 V2000
4.5750 -3.7250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.7542 -2.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7542 -3.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2792 -4.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5792 -2.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8917 -2.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6042 -2.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8375 -3.7250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.0375 -2.4917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.3167 -2.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9917 -3.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0417 -3.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0000 -2.9125 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.2750 -4.9625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9875 -4.1667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.1167 -2.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4083 -3.2375 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.2917 -2.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7042 -4.1500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6042 -1.6625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.1750 -4.3167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4250 -3.7417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3167 -3.7250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.2667 -3.7542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5542 -5.3667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2625 -4.7042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5542 -4.1667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1292 -4.1625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9875 -5.3792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8417 -3.7542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8917 -1.2500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.9792 -4.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6917 -3.7542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8375 -5.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5542 -4.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1250 -4.9875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8917 -0.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4042 -4.1667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6917 -5.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4042 -5.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3198 -1.9384 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2 5 1 0
3 1 1 0
4 1 1 0
5 1 1 0
6 7 1 0
7 10 1 0
8 6 1 0
2 9 1 1
10 9 1 0
11 4 2 0
12 8 2 0
13 18 1 0
14 4 1 0
15 24 1 0
16 6 2 0
17 16 1 0
5 18 1 0
19 11 1 0
20 7 2 0
21 3 2 0
22 19 2 0
23 10 2 0
24 27 1 0
25 14 2 0
26 12 1 0
27 30 2 0
28 22 1 0
29 14 1 0
30 28 1 0
31 20 1 0
32 15 2 0
33 15 1 0
34 36 1 0
35 34 2 0
36 28 2 0
37 31 1 0
38 33 2 0
39 32 1 0
40 38 1 0
3 2 1 0
11 13 1 0
17 12 1 0
27 35 1 0
39 40 2 0
5 41 1 6
M CHG 2 15 1 29 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 576.66Molecular Weight (Monoisotopic): 576.1250AlogP: 0.53#Rotatable Bonds: 9Polar Surface Area: 153.92Molecular Species: ACIDHBA: 10HBD: 2#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.51CX Basic pKa: 3.02CX LogP: -2.60CX LogD: -2.32Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.16Np Likeness Score: -0.25
References 1. Aszodi J, Bonnet A, Chantot J, Costerousse G, Didierlaurent S, Teutsch G. (1993) Vinylogous vs arylogous isocephems, 3 (11): [10.1016/S0960-894X(01)80930-6 ]