The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-((6S,7S)-7-{2-(2-Amino-thiazol-4-yl)-2-[(E)-methoxyimino]-acetylamino}-2-carboxy-8-oxo-4-thia-1-aza-bicyclo[4.2.0]oct-2-en-3-ylmethyl)-thieno[2,3-b]pyridin-7-ium ID: ALA3559436
PubChem CID: 118753759
Max Phase: Preclinical
Molecular Formula: C21H18N6O5S3
Molecular Weight: 530.61
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CO/N=C(/C(=O)N[C@@H]1C(=O)N2C(C(=O)[O-])=C(C[n+]3cccc4ccsc43)SC[C@H]12)c1csc(N)n1
Standard InChI: InChI=1S/C21H18N6O5S3/c1-32-25-14(11-8-35-21(22)23-11)17(28)24-15-12-9-34-13(16(20(30)31)27(12)18(15)29)7-26-5-2-3-10-4-6-33-19(10)26/h2-6,8,12,15H,7,9H2,1H3,(H3-,22,23,24,28,30,31)/b25-14+/t12-,15+/m1/s1
Standard InChI Key: PANLALCDUYIQBY-ZGBRBAIOSA-N
Molfile:
RDKit 2D
36 40 0 0 1 0 0 0 0 0999 V2000
3.6374 -2.3818 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7644 -2.0798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9230 -2.7943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0499 -1.6673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3519 -2.7943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9230 -3.6193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2085 -4.8568 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5249 -2.8195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9415 -2.2361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3958 -3.6344 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5613 -1.8663 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1447 -2.4497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4940 -5.2693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6374 -4.0318 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.1309 -4.0089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2085 -4.0318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2085 -2.3818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3398 -2.6905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7143 -3.4255 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.3519 -3.6193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7094 -5.0144 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.1551 -1.4393 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8364 -0.8704 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2245 -5.6818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4940 -6.0943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9311 -3.2466 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7094 -6.3492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4940 -2.7943 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2600 -4.8237 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.9230 -5.2693 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2085 -1.5568 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9520 -1.2257 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9230 -6.0943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2085 -6.5068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1655 -0.4288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1488 -3.0078 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2 5 1 0
3 1 1 0
4 1 1 0
5 1 1 0
6 3 2 0
7 16 1 0
8 9 1 0
9 12 1 0
10 8 1 0
2 11 1 1
12 11 1 0
13 7 2 0
14 20 1 0
15 10 2 0
16 6 1 0
17 3 1 0
18 8 2 0
19 18 1 0
5 20 1 0
21 13 1 0
22 9 2 0
23 4 2 0
24 21 1 0
25 13 1 0
26 12 2 0
27 25 1 0
28 17 2 0
29 15 1 0
30 7 1 0
31 17 1 0
32 22 1 0
33 30 2 0
34 33 1 0
35 32 1 0
2 4 1 0
6 14 1 0
25 34 2 0
24 27 2 0
19 15 1 0
5 36 1 6
M CHG 2 7 1 31 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 530.61Molecular Weight (Monoisotopic): 530.0501AlogP: -0.32#Rotatable Bonds: 7Polar Surface Area: 153.92Molecular Species: ACIDHBA: 11HBD: 2#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 2.92CX Basic pKa: 3.53CX LogP: -3.75CX LogD: -3.42Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.18Np Likeness Score: -0.49
References 1. Aszodi J, Bonnet A, Chantot J, Costerousse G, Didierlaurent S, Teutsch G. (1993) Vinylogous vs arylogous isocephems, 3 (11): [10.1016/S0960-894X(01)80930-6 ]