[(Z)-3-((6S,7S)-7-{2-(2-Amino-thiazol-4-yl)-2-[(E)-methoxyimino]-acetylamino}-2-carboxy-8-oxo-4-thia-1-aza-bicyclo[4.2.0]oct-2-en-3-yl)-allyl]-trimethyl-ammonium

ID: ALA3559438

PubChem CID: 118753761

Max Phase: Preclinical

Molecular Formula: C19H24N6O5S2

Molecular Weight: 480.57

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CO/N=C(/C(=O)N[C@@H]1C(=O)N2C(C(=O)[O-])=C(/C=C\C[N+](C)(C)C)SC[C@H]12)c1csc(N)n1

Standard InChI:  InChI=1S/C19H24N6O5S2/c1-25(2,3)7-5-6-12-15(18(28)29)24-11(9-31-12)14(17(24)27)22-16(26)13(23-30-4)10-8-32-19(20)21-10/h5-6,8,11,14H,7,9H2,1-4H3,(H3-,20,21,22,26,28,29)/b6-5-,23-13+/t11-,14+/m1/s1

Standard InChI Key:  AYTVKFGRFVPYNC-QXYQUVDBSA-N

Molfile:  

     RDKit          2D

 33 35  0  0  1  0  0  0  0  0999 V2000
    4.5750   -3.7250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.7542   -2.9042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7542   -3.7292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2792   -4.1292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5792   -2.9042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8917   -2.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6042   -2.4875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8375   -3.7250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.0375   -2.4917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.3167   -2.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0417   -3.9292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9917   -3.7292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0000   -2.9125    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.2750   -4.9625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1167   -2.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4083   -3.2375    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    5.2917   -2.4917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6042   -1.6625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1750   -4.3167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6417   -3.6000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5792   -4.3167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3167   -3.7250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4042   -4.3167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5542   -5.3667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2625   -4.7042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.9875   -5.3792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8167   -3.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8917   -1.2500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0542   -2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0542   -4.3167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0542   -3.0167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8917   -0.4250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3198   -1.9384    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  5  1  0
  3  1  1  0
  4  1  1  0
  5  1  1  0
  6  7  1  0
  7 10  1  0
  8  6  1  0
  2  9  1  1
 10  9  1  0
 11  8  2  0
 12  4  2  0
 13 17  1  0
 14  4  1  0
 15  6  2  0
 16 15  1  0
  5 17  1  0
 18  7  2  0
 19  3  2  0
 20 27  1  0
 21 12  1  0
 22 10  2  0
 23 21  2  0
 24 14  2  0
 25 11  1  0
 26 14  1  0
 27 23  1  0
 28 18  1  0
 29 20  1  0
 30 20  1  0
 31 20  1  0
 32 28  1  0
  2  3  1  0
 12 13  1  0
 16 11  1  0
  5 33  1  6
M  CHG  2  20   1  26  -1
M  END

Alternative Forms

  1. Parent:

    ALA3559438

    ---

Associated Targets(non-human)

Staphylococcus sp. (496 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Enterobacteriaceae (669 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 480.57Molecular Weight (Monoisotopic): 480.1250AlogP: -1.26#Rotatable Bonds: 8
Polar Surface Area: 150.04Molecular Species: ACIDHBA: 10HBD: 2
#RO5 Violations: HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 3.79CX Basic pKa: 3.03CX LogP: -4.74CX LogD: -3.84
Aromatic Rings: 1Heavy Atoms: 32QED Weighted: 0.20Np Likeness Score: -0.08

References

1. Aszodi J, Bonnet A, Chantot J, Costerousse G, Didierlaurent S, Teutsch G.  (1993)  Vinylogous vs arylogous isocephems,  (11): [10.1016/S0960-894X(01)80930-6]

Source