The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
[(Z)-3-((6S,7S)-7-{2-(2-Amino-thiazol-4-yl)-2-[(E)-methoxyimino]-acetylamino}-2-carboxy-8-oxo-4-thia-1-aza-bicyclo[4.2.0]oct-2-en-3-yl)-allyl]-trimethyl-ammonium ID: ALA3559438
PubChem CID: 118753761
Max Phase: Preclinical
Molecular Formula: C19H24N6O5S2
Molecular Weight: 480.57
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CO/N=C(/C(=O)N[C@@H]1C(=O)N2C(C(=O)[O-])=C(/C=C\C[N+](C)(C)C)SC[C@H]12)c1csc(N)n1
Standard InChI: InChI=1S/C19H24N6O5S2/c1-25(2,3)7-5-6-12-15(18(28)29)24-11(9-31-12)14(17(24)27)22-16(26)13(23-30-4)10-8-32-19(20)21-10/h5-6,8,11,14H,7,9H2,1-4H3,(H3-,20,21,22,26,28,29)/b6-5-,23-13+/t11-,14+/m1/s1
Standard InChI Key: AYTVKFGRFVPYNC-QXYQUVDBSA-N
Molfile:
RDKit 2D
33 35 0 0 1 0 0 0 0 0999 V2000
4.5750 -3.7250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.7542 -2.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7542 -3.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2792 -4.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5792 -2.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8917 -2.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6042 -2.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8375 -3.7250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.0375 -2.4917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.3167 -2.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0417 -3.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9917 -3.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0000 -2.9125 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.2750 -4.9625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1167 -2.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4083 -3.2375 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.2917 -2.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6042 -1.6625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.1750 -4.3167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6417 -3.6000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5792 -4.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3167 -3.7250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4042 -4.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5542 -5.3667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2625 -4.7042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9875 -5.3792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8167 -3.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8917 -1.2500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0542 -2.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0542 -4.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0542 -3.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8917 -0.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3198 -1.9384 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2 5 1 0
3 1 1 0
4 1 1 0
5 1 1 0
6 7 1 0
7 10 1 0
8 6 1 0
2 9 1 1
10 9 1 0
11 8 2 0
12 4 2 0
13 17 1 0
14 4 1 0
15 6 2 0
16 15 1 0
5 17 1 0
18 7 2 0
19 3 2 0
20 27 1 0
21 12 1 0
22 10 2 0
23 21 2 0
24 14 2 0
25 11 1 0
26 14 1 0
27 23 1 0
28 18 1 0
29 20 1 0
30 20 1 0
31 20 1 0
32 28 1 0
2 3 1 0
12 13 1 0
16 11 1 0
5 33 1 6
M CHG 2 20 1 26 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 480.57Molecular Weight (Monoisotopic): 480.1250AlogP: -1.26#Rotatable Bonds: 8Polar Surface Area: 150.04Molecular Species: ACIDHBA: 10HBD: 2#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.79CX Basic pKa: 3.03CX LogP: -4.74CX LogD: -3.84Aromatic Rings: 1Heavy Atoms: 32QED Weighted: 0.20Np Likeness Score: -0.08
References 1. Aszodi J, Bonnet A, Chantot J, Costerousse G, Didierlaurent S, Teutsch G. (1993) Vinylogous vs arylogous isocephems, 3 (11): [10.1016/S0960-894X(01)80930-6 ]