The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
((6S,7S)-7-{2-(2-Amino-thiazol-4-yl)-2-[(E)-methoxyimino]-acetylamino}-2-carboxy-8-oxo-4-thia-1-aza-bicyclo[4.2.0]oct-2-en-3-ylmethyl)-trimethyl-ammonium ID: ALA3559440
PubChem CID: 118753763
Max Phase: Preclinical
Molecular Formula: C17H22N6O5S2
Molecular Weight: 454.53
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CO/N=C(/C(=O)N[C@@H]1C(=O)N2C(C(=O)[O-])=C(C[N+](C)(C)C)SC[C@H]12)c1csc(N)n1
Standard InChI: InChI=1S/C17H22N6O5S2/c1-23(2,3)5-10-13(16(26)27)22-9(7-29-10)12(15(22)25)20-14(24)11(21-28-4)8-6-30-17(18)19-8/h6,9,12H,5,7H2,1-4H3,(H3-,18,19,20,24,26,27)/b21-11+/t9-,12+/m1/s1
Standard InChI Key: UOEDPNMRZHOLNZ-GNWUKDCASA-N
Molfile:
RDKit 2D
31 33 0 0 1 0 0 0 0 0999 V2000
4.5750 -3.7250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.7542 -2.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2792 -4.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7542 -3.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5792 -2.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9917 -3.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8917 -2.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6042 -2.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8375 -3.7250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.0375 -2.4917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.3167 -2.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0000 -2.9125 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.0417 -3.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2750 -4.9625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1167 -2.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4083 -3.2375 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
5.2917 -2.4917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7042 -4.1500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6042 -1.6625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.1750 -4.3167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4250 -3.7417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.3167 -3.7250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5542 -5.3667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2625 -4.7042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9875 -5.3792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8917 -1.2500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1292 -4.1625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4292 -2.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6292 -4.5417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8917 -0.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3198 -1.9384 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2 5 1 0
3 1 1 0
4 1 1 0
5 1 1 0
6 3 2 0
7 8 1 0
8 11 1 0
9 7 1 0
2 10 1 1
11 10 1 0
12 17 1 0
13 9 2 0
14 3 1 0
15 7 2 0
16 15 1 0
5 17 1 0
18 6 1 0
19 8 2 0
20 4 2 0
21 18 1 0
22 11 2 0
23 14 2 0
24 13 1 0
25 14 1 0
26 19 1 0
27 21 1 0
28 21 1 0
29 21 1 0
30 26 1 0
2 4 1 0
6 12 1 0
16 13 1 0
5 31 1 6
M CHG 2 21 1 25 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 454.53Molecular Weight (Monoisotopic): 454.1093AlogP: -1.81#Rotatable Bonds: 7Polar Surface Area: 150.04Molecular Species: ACIDHBA: 10HBD: 2#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.75CX Basic pKa: 2.98CX LogP: -5.24CX LogD: -4.36Aromatic Rings: 1Heavy Atoms: 30QED Weighted: 0.21Np Likeness Score: -0.21
References 1. Aszodi J, Bonnet A, Chantot J, Costerousse G, Didierlaurent S, Teutsch G. (1993) Vinylogous vs arylogous isocephems, 3 (11): [10.1016/S0960-894X(01)80930-6 ]