2-Amino-1-(11-amino-undecyl)-3-benzyl-3H-benzoimidazol-1-ium

ID: ALA3559457

PubChem CID: 118753780

Max Phase: Preclinical

Molecular Formula: C27H38N4O4

Molecular Weight: 393.60

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  NCCCCCCCCCCC[n+]1c(N)n(Cc2ccccc2)c2ccccc21.O=C([O-])C(=O)O

Standard InChI:  InChI=1S/C25H36N4.C2H2O4/c26-19-13-6-4-2-1-3-5-7-14-20-28-23-17-11-12-18-24(23)29(25(28)27)21-22-15-9-8-10-16-22;3-1(4)2(5)6/h8-12,15-18,27H,1-7,13-14,19-21,26H2;(H,3,4)(H,5,6)

Standard InChI Key:  PRSCAEYFXMJDEV-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 36  0  0  0  0  0  0  0  0999 V2000
   -0.8315   -7.5864    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5918   -7.8897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1153   -7.2498    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8772   -6.7679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6749   -6.5560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9380   -7.2914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7912   -8.6874    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1335   -8.0393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3867   -6.6059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2955   -6.1821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8868   -5.7583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7439   -8.1223    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.0003   -8.4755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2093   -6.6515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0127   -5.8705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6061   -7.6611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3147   -8.0143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4604   -7.8232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1542   -8.2761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8938   -7.9146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5793   -8.3758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2999   -8.1140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0353   -7.7401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7250   -8.1888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3134   -5.1807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5074   -5.3968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6580   -5.9577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4697   -5.1807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2841   -5.2223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6568   -2.9063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3698   -3.3191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9438   -3.3191    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0828   -2.9063    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6568   -2.0765    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3698   -4.1447    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  1  1  0
  5  4  2  0
  6  3  1  0
  7  2  1  0
  8  1  1  0
  9  6  1  0
 10  4  1  0
 11  5  1  0
 12 13  1  0
 13 17  1  0
 14  9  1  0
 15  9  2  0
 16  8  1  0
 17 21  1  0
 18 24  1  0
 19 18  1  0
 20 19  1  0
 21 20  1  0
 22 16  1  0
 23 22  1  0
 24 23  1  0
 25 26  1  0
 26 10  2  0
 27 14  2  0
 28 15  1  0
 29 28  2  0
  3  5  1  0
 11 25  2  0
 27 29  1  0
 31 30  1  0
 32 30  1  0
 33 31  1  0
 34 30  2  0
 35 31  2  0
M  CHG  2   1   1  32  -1
M  END

Associated Targets(non-human)

hprK HPr kinase (97 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 393.60Molecular Weight (Monoisotopic): 393.3013AlogP: 5.03#Rotatable Bonds: 13
Polar Surface Area: 60.85Molecular Species: BASEHBA: 3HBD: 2
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 10.21CX LogP: 1.57CX LogD: -1.04
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.32Np Likeness Score: -0.37

References

1. Ramström H, Bourotte M, Philippe C, Schmitt M, Haiech J, Bourguignon JJ..  (2004)  Heterocyclic bis-cations as starting hits for design of inhibitors of the bifunctional enzyme histidine-containing protein kinase/phosphatase from Bacillus subtilis.,  47  (9): [PMID:15084125] [10.1021/jm021043o]

Source