The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Amino-1-(11-amino-undecyl)-3-benzyl-3H-benzoimidazol-1-ium ID: ALA3559457
PubChem CID: 118753780
Max Phase: Preclinical
Molecular Formula: C27H38N4O4
Molecular Weight: 393.60
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: NCCCCCCCCCCC[n+]1c(N)n(Cc2ccccc2)c2ccccc21.O=C([O-])C(=O)O
Standard InChI: InChI=1S/C25H36N4.C2H2O4/c26-19-13-6-4-2-1-3-5-7-14-20-28-23-17-11-12-18-24(23)29(25(28)27)21-22-15-9-8-10-16-22;3-1(4)2(5)6/h8-12,15-18,27H,1-7,13-14,19-21,26H2;(H,3,4)(H,5,6)
Standard InChI Key: PRSCAEYFXMJDEV-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 36 0 0 0 0 0 0 0 0999 V2000
-0.8315 -7.5864 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.5918 -7.8897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1153 -7.2498 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.8772 -6.7679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6749 -6.5560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9380 -7.2914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7912 -8.6874 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.1335 -8.0393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3867 -6.6059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2955 -6.1821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8868 -5.7583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7439 -8.1223 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0003 -8.4755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2093 -6.6515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0127 -5.8705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6061 -7.6611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3147 -8.0143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4604 -7.8232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1542 -8.2761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8938 -7.9146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5793 -8.3758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2999 -8.1140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0353 -7.7401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7250 -8.1888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3134 -5.1807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5074 -5.3968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6580 -5.9577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4697 -5.1807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2841 -5.2223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6568 -2.9063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3698 -3.3191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9438 -3.3191 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0828 -2.9063 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6568 -2.0765 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3698 -4.1447 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 1 1 0
5 4 2 0
6 3 1 0
7 2 1 0
8 1 1 0
9 6 1 0
10 4 1 0
11 5 1 0
12 13 1 0
13 17 1 0
14 9 1 0
15 9 2 0
16 8 1 0
17 21 1 0
18 24 1 0
19 18 1 0
20 19 1 0
21 20 1 0
22 16 1 0
23 22 1 0
24 23 1 0
25 26 1 0
26 10 2 0
27 14 2 0
28 15 1 0
29 28 2 0
3 5 1 0
11 25 2 0
27 29 1 0
31 30 1 0
32 30 1 0
33 31 1 0
34 30 2 0
35 31 2 0
M CHG 2 1 1 32 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 393.60Molecular Weight (Monoisotopic): 393.3013AlogP: 5.03#Rotatable Bonds: 13Polar Surface Area: 60.85Molecular Species: BASEHBA: 3HBD: 2#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 10.21CX LogP: 1.57CX LogD: -1.04Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.32Np Likeness Score: -0.37
References 1. Ramström H, Bourotte M, Philippe C, Schmitt M, Haiech J, Bourguignon JJ.. (2004) Heterocyclic bis-cations as starting hits for design of inhibitors of the bifunctional enzyme histidine-containing protein kinase/phosphatase from Bacillus subtilis., 47 (9): [PMID:15084125 ] [10.1021/jm021043o ]