2-Amino-3-benzyl-1-(3-phenyl-propyl)-3H-benzoimidazol-1-ium

ID: ALA3559460

PubChem CID: 118753783

Max Phase: Preclinical

Molecular Formula: C25H25N3O4

Molecular Weight: 342.47

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Nc1n(Cc2ccccc2)c2ccccc2[n+]1CCCc1ccccc1.O=C([O-])C(=O)O

Standard InChI:  InChI=1S/C23H23N3.C2H2O4/c24-23-25(17-9-14-19-10-3-1-4-11-19)21-15-7-8-16-22(21)26(23)18-20-12-5-2-6-13-20;3-1(4)2(5)6/h1-8,10-13,15-16,24H,9,14,17-18H2;(H,3,4)(H,5,6)

Standard InChI Key:  DTQKSNUJRLHZGJ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 34  0  0  0  0  0  0  0  0999 V2000
    1.5141   -7.0409    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7530   -7.3486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2290   -6.7040    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4725   -6.2257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6781   -6.0136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5945   -6.7539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5534   -8.1513    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.2128   -7.4983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0437   -6.0635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0506   -5.6393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4618   -5.2192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9573   -7.1157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3838   -7.1989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6477   -7.5732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6694   -5.3315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8672   -6.1051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0784   -7.6481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4337   -6.3671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0400   -4.6328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8385   -4.8574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3164   -5.4189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8145   -7.2738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1699   -5.9928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1186   -4.6328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9421   -4.6827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8644   -6.4503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6568   -2.9063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3698   -3.3191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9438   -3.3191    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0828   -2.9063    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6568   -2.0765    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3698   -4.1447    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  1  1  0
  5  4  2  0
  6  3  1  0
  7  2  1  0
  8  1  1  0
  9  6  1  0
 10  4  1  0
 11  5  1  0
 12  8  1  0
 13 14  1  0
 14 12  1  0
 15  9  2  0
 16  9  1  0
 17 13  2  0
 18 13  1  0
 19 20  1  0
 20 10  2  0
 21 16  2  0
 22 17  1  0
 23 18  2  0
 24 15  1  0
 25 21  1  0
 26 23  1  0
  3  5  1  0
 11 19  2  0
 26 22  2  0
 25 24  2  0
 28 27  1  0
 29 27  1  0
 30 28  1  0
 31 27  2  0
 32 28  2  0
M  CHG  2   1   1  29  -1
M  END

Associated Targets(non-human)

hprK HPr kinase (97 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 342.47Molecular Weight (Monoisotopic): 342.1965AlogP: 4.19#Rotatable Bonds: 6
Polar Surface Area: 34.83Molecular Species: NEUTRALHBA: 2HBD: 1
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 1.13CX LogD: 1.13
Aromatic Rings: 4Heavy Atoms: 26QED Weighted: 0.52Np Likeness Score: -0.55

References

1. Ramström H, Bourotte M, Philippe C, Schmitt M, Haiech J, Bourguignon JJ..  (2004)  Heterocyclic bis-cations as starting hits for design of inhibitors of the bifunctional enzyme histidine-containing protein kinase/phosphatase from Bacillus subtilis.,  47  (9): [PMID:15084125] [10.1021/jm021043o]

Source