2-Amino-3-benzyl-1-[5-(4-phenyl-piperazin-1-yl)-pentyl]-3H-benzoimidazol-1-ium

ID: ALA3559463

PubChem CID: 118753786

Max Phase: Preclinical

Molecular Formula: C31H37N5O4

Molecular Weight: 454.64

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Nc1n(Cc2ccccc2)c2ccccc2[n+]1CCCCCN1CCN(c2ccccc2)CC1.O=C([O-])C(=O)O

Standard InChI:  InChI=1S/C29H35N5.C2H2O4/c30-29-33(27-16-8-9-17-28(27)34(29)24-25-12-4-1-5-13-25)19-11-3-10-18-31-20-22-32(23-21-31)26-14-6-2-7-15-26;3-1(4)2(5)6/h1-2,4-9,12-17,30H,3,10-11,18-24H2;(H,3,4)(H,5,6)

Standard InChI Key:  GWVMLQUQOKFCIO-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 40 43  0  0  0  0  0  0  0  0999 V2000
    2.1939   -6.5497    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4336   -6.8531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9101   -6.2132    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1482   -5.7313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3505   -5.5194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9649   -6.0512    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0874   -6.2548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4858   -6.7866    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2342   -7.6508    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.9150   -6.8655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2711   -5.5942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7045   -5.6814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8919   -7.0026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5357   -5.9639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1713   -7.2395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3613   -5.5692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7299   -5.1455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1386   -4.7217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7504   -7.1522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3900   -6.1384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7543   -4.8588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1839   -5.6149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0127   -4.8338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6315   -6.6245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0607   -6.7035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3253   -7.0774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7120   -4.1441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5180   -4.3602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4897   -4.4848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1254   -5.7687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6326   -4.9211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4443   -4.1441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2587   -4.1857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1835   -4.9460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6568   -2.9063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3698   -3.3191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9438   -3.3191    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0828   -2.9063    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6568   -2.0765    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3698   -4.1447    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  1  1  0
  5  4  2  0
  6 10  1  0
  7  3  1  0
  8 19  1  0
  9  2  1  0
 10 15  1  0
 11 14  1  0
 12  6  1  0
 13  1  1  0
 14  8  1  0
 15  8  1  0
 16  7  1  0
 17  4  1  0
 18  5  1  0
 19 25  1  0
 20 12  2  0
 21 12  1  0
 22 16  1  0
 23 16  2  0
 24 13  1  0
 25 26  1  0
 26 24  1  0
 27 28  1  0
 28 17  2  0
 29 21  2  0
 30 20  1  0
 31 22  2  0
 32 23  1  0
 33 32  2  0
 34 29  1  0
  3  5  1  0
 27 18  2  0
 31 33  1  0
  6 11  1  0
 34 30  2  0
 36 35  1  0
 37 35  1  0
 38 36  1  0
 39 35  2  0
 40 36  2  0
M  CHG  2   1   1  37  -1
M  END

Associated Targets(non-human)

hprK HPr kinase (97 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 454.64Molecular Weight (Monoisotopic): 454.2965AlogP: 4.55#Rotatable Bonds: 9
Polar Surface Area: 41.31Molecular Species: BASEHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.50CX LogP: 1.45CX LogD: 0.32
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.30Np Likeness Score: -1.07

References

1. Ramström H, Bourotte M, Philippe C, Schmitt M, Haiech J, Bourguignon JJ..  (2004)  Heterocyclic bis-cations as starting hits for design of inhibitors of the bifunctional enzyme histidine-containing protein kinase/phosphatase from Bacillus subtilis.,  47  (9): [PMID:15084125] [10.1021/jm021043o]

Source