2-Amino-1,3-dibenzyl-3H-benzoimidazol-1-ium

ID: ALA3559464

PubChem CID: 118753787

Max Phase: Preclinical

Molecular Formula: C23H21N3O4

Molecular Weight: 314.41

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Nc1n(Cc2ccccc2)c2ccccc2[n+]1Cc1ccccc1.O=C([O-])C(=O)O

Standard InChI:  InChI=1S/C21H19N3.C2H2O4/c22-21-23(15-17-9-3-1-4-10-17)19-13-7-8-14-20(19)24(21)16-18-11-5-2-6-12-18;3-1(4)2(5)6/h1-14,22H,15-16H2;(H,3,4)(H,5,6)

Standard InChI Key:  BSZIYOJFAUNZEP-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
    1.9001   -7.1488    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1383   -7.4568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6139   -6.8116    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8584   -6.3329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0634   -6.1206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5993   -7.6066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2103   -6.8616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9385   -8.2601    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.3444   -7.2237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6598   -6.1706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4370   -5.7460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8469   -5.3257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2852   -5.4380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4840   -6.2122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0353   -7.6732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3860   -6.3995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4255   -4.7388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2247   -4.9635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9335   -5.5254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7721   -7.2944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1228   -6.0207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7347   -4.7388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5589   -4.7887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8095   -6.4703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6568   -2.9063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3698   -3.3191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9438   -3.3191    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0828   -2.9063    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6568   -2.0765    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3698   -4.1447    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  1  1  0
  5  4  2  0
  6  1  1  0
  7  3  1  0
  8  2  1  0
  9  6  1  0
 10  7  1  0
 11  4  1  0
 12  5  1  0
 13 10  2  0
 14 10  1  0
 15  9  2  0
 16  9  1  0
 17 18  1  0
 18 11  2  0
 19 14  2  0
 20 15  1  0
 21 16  2  0
 22 13  1  0
 23 19  1  0
 24 21  1  0
  3  5  1  0
 12 17  2  0
 24 20  2  0
 23 22  2  0
 26 25  1  0
 27 25  1  0
 28 26  1  0
 29 25  2  0
 30 26  2  0
M  CHG  2   1   1  27  -1
M  END

Associated Targets(non-human)

hprK HPr kinase (97 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 314.41Molecular Weight (Monoisotopic): 314.1652AlogP: 3.61#Rotatable Bonds: 4
Polar Surface Area: 34.83Molecular Species: NEUTRALHBA: 2HBD: 1
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 0.40CX LogD: 0.40
Aromatic Rings: 4Heavy Atoms: 24QED Weighted: 0.57Np Likeness Score: -0.67

References

1. Ramström H, Bourotte M, Philippe C, Schmitt M, Haiech J, Bourguignon JJ..  (2004)  Heterocyclic bis-cations as starting hits for design of inhibitors of the bifunctional enzyme histidine-containing protein kinase/phosphatase from Bacillus subtilis.,  47  (9): [PMID:15084125] [10.1021/jm021043o]

Source