2-Amino-1-dodecyl-3-phenethyl-3H-benzoimidazol-1-ium

ID: ALA3559465

PubChem CID: 118753788

Max Phase: Preclinical

Molecular Formula: C29H41N3O4

Molecular Weight: 406.64

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCCCCCCC[n+]1c(N)n(CCc2ccccc2)c2ccccc21.O=C([O-])C(=O)O

Standard InChI:  InChI=1S/C27H39N3.C2H2O4/c1-2-3-4-5-6-7-8-9-10-16-22-29-25-19-14-15-20-26(25)30(27(29)28)23-21-24-17-12-11-13-18-24;3-1(4)2(5)6/h11-15,17-20,28H,2-10,16,21-23H2,1H3;(H,3,4)(H,5,6)

Standard InChI Key:  XPJXOSLDVGNEON-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 37  0  0  0  0  0  0  0  0999 V2000
    1.3231   -6.3878    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.5620   -6.6914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0380   -6.0509    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2815   -5.5685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4871   -5.3564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7855   -6.0925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3624   -7.4900    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.0218   -6.8412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2347   -5.4063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8596   -4.9821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2708   -4.5578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0582   -5.4520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7662   -6.4626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5074   -4.7575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4325   -6.1799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1587   -7.2779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4850   -6.8162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1928   -6.5417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4567   -6.9160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7446   -7.1780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0584   -6.7164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3139   -7.0782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6277   -6.6249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8874   -6.9909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6475   -4.1960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8490   -3.9797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9073   -6.9243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3309   -4.8032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2560   -6.2298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7052   -5.5393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6568   -2.9063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3698   -3.3191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9438   -3.3191    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0828   -2.9063    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6568   -2.0765    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3698   -4.1447    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  1  1  0
  5  4  2  0
  6  3  1  0
  7  2  1  0
  8  1  1  0
  9  6  1  0
 10  4  1  0
 11  5  1  0
 12  9  1  0
 13  8  1  0
 14 12  2  0
 15 12  1  0
 16 17  1  0
 17 20  1  0
 18 19  1  0
 19 13  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 18  1  0
 25 10  2  0
 26 25  1  0
 27 16  1  0
 28 14  1  0
 29 15  2  0
 30 29  1  0
  3  5  1  0
 11 26  2  0
 30 28  2  0
 32 31  1  0
 33 31  1  0
 34 32  1  0
 35 31  2  0
 36 32  2  0
M  CHG  2   1   1  33  -1
M  END

Associated Targets(non-human)

hprK HPr kinase (97 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 406.64Molecular Weight (Monoisotopic): 406.3217AlogP: 6.67#Rotatable Bonds: 14
Polar Surface Area: 34.83Molecular Species: NEUTRALHBA: 2HBD: 1
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 3.84CX LogD: 3.84
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.24Np Likeness Score: -0.42

References

1. Ramström H, Bourotte M, Philippe C, Schmitt M, Haiech J, Bourguignon JJ..  (2004)  Heterocyclic bis-cations as starting hits for design of inhibitors of the bifunctional enzyme histidine-containing protein kinase/phosphatase from Bacillus subtilis.,  47  (9): [PMID:15084125] [10.1021/jm021043o]

Source