2-Amino-3-benzyl-1-dodecyl-3H-benzoimidazol-1-ium

ID: ALA3559471

PubChem CID: 118753793

Max Phase: Preclinical

Molecular Formula: C28H39N3O4

Molecular Weight: 392.61

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCCCCCCC[n+]1c(N)n(Cc2ccccc2)c2ccccc21.O=C([O-])C(=O)O

Standard InChI:  InChI=1S/C26H37N3.C2H2O4/c1-2-3-4-5-6-7-8-9-10-16-21-28-24-19-14-15-20-25(24)29(26(28)27)22-23-17-12-11-13-18-23;3-1(4)2(5)6/h11-15,17-20,27H,2-10,16,21-22H2,1H3;(H,3,4)(H,5,6)

Standard InChI Key:  VJUSTJPDOPPMDG-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 36  0  0  0  0  0  0  0  0999 V2000
    0.4355   -6.4918    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3249   -6.7992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8484   -6.1552    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3898   -5.6774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4079   -5.4655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6710   -6.2051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5243   -7.6011    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1335   -6.9488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1197   -5.5154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9714   -5.0916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6198   -4.6720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9424   -5.5569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7458   -4.7842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8730   -6.5666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2672   -7.3892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5817   -6.9238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4212   -7.1898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7274   -6.7286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9920   -7.1025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3022   -6.6496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5669   -7.0235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8463   -7.2853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1608   -6.8241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7595   -4.3105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0465   -4.0862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0109   -7.0277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3911   -4.8714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2028   -4.0862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0171   -4.1360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6568   -2.9063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3698   -3.3191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9438   -3.3191    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0828   -2.9063    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6568   -2.0765    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3698   -4.1447    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  1  1  0
  5  4  2  0
  6  3  1  0
  7  2  1  0
  8  1  1  0
  9  6  1  0
 10  4  1  0
 11  5  1  0
 12  9  1  0
 13  9  2  0
 14  8  1  0
 15 16  1  0
 16 22  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 14  1  0
 22 23  1  0
 23 17  1  0
 24 10  2  0
 25 24  1  0
 26 15  1  0
 27 12  2  0
 28 13  1  0
 29 28  2  0
  3  5  1  0
 11 25  2  0
 29 27  1  0
 31 30  1  0
 32 30  1  0
 33 31  1  0
 34 30  2  0
 35 31  2  0
M  CHG  2   1   1  32  -1
M  END

Associated Targets(non-human)

hprK HPr kinase (97 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 392.61Molecular Weight (Monoisotopic): 392.3060AlogP: 6.48#Rotatable Bonds: 13
Polar Surface Area: 34.83Molecular Species: NEUTRALHBA: 2HBD: 1
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 3.55CX LogD: 3.55
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.26Np Likeness Score: -0.44

References

1. Ramström H, Bourotte M, Philippe C, Schmitt M, Haiech J, Bourguignon JJ..  (2004)  Heterocyclic bis-cations as starting hits for design of inhibitors of the bifunctional enzyme histidine-containing protein kinase/phosphatase from Bacillus subtilis.,  47  (9): [PMID:15084125] [10.1021/jm021043o]

Source