2-Amino-3-(4-chloro-benzyl)-1-dodecyl-3H-benzoimidazol-1-ium

ID: ALA3559473

PubChem CID: 118753795

Max Phase: Preclinical

Molecular Formula: C28H38ClN3O4

Molecular Weight: 427.06

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCCCCCCC[n+]1c(N)n(Cc2ccc(Cl)cc2)c2ccccc21.O=C([O-])C(=O)O

Standard InChI:  InChI=1S/C26H36ClN3.C2H2O4/c1-2-3-4-5-6-7-8-9-10-13-20-29-24-14-11-12-15-25(24)30(26(29)28)21-22-16-18-23(27)19-17-22;3-1(4)2(5)6/h11-12,14-19,28H,2-10,13,20-21H2,1H3;(H,3,4)(H,5,6)

Standard InChI Key:  FFAGFRHZGPPBEP-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 37  0  0  0  0  0  0  0  0999 V2000
    1.1575   -7.2023    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3963   -7.5018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1278   -6.8654    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1159   -6.3787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3214   -6.1666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9514   -6.9111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1966   -8.3088    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8563   -7.6516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4007   -6.2165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2992   -4.8396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7484   -4.1450    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    1.6941   -5.7922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1051   -5.3762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0263   -5.4885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2243   -6.2664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6735   -5.5759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4756   -4.7939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6009   -7.2772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0026   -8.0966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3204   -7.6266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4627   -7.4394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7223   -7.8096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0277   -7.3521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2914   -7.7264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5800   -7.9885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8936   -7.5268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1491   -7.8970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4820   -5.0143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6833   -4.7939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7430   -7.7389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6568   -2.9063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3698   -3.3191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9438   -3.3191    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0828   -2.9063    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6568   -2.0765    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3698   -4.1447    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  1  1  0
  5  4  2  0
  6  3  1  0
  7  2  1  0
  8  1  1  0
  9  6  1  0
 10 16  1  0
 11 10  1  0
 12  4  1  0
 13  5  1  0
 14  9  2  0
 15  9  1  0
 16 15  2  0
 17 14  1  0
 18  8  1  0
 19 20  1  0
 20 25  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 18  1  0
 25 26  1  0
 26 27  1  0
 27 21  1  0
 28 12  2  0
 29 28  1  0
 30 19  1  0
  3  5  1  0
 13 29  2  0
 10 17  2  0
 32 31  1  0
 33 31  1  0
 34 32  1  0
 35 31  2  0
 36 32  2  0
M  CHG  2   1   1  33  -1
M  END

Associated Targets(non-human)

hprK HPr kinase (97 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 427.06Molecular Weight (Monoisotopic): 426.2671AlogP: 7.13#Rotatable Bonds: 13
Polar Surface Area: 34.83Molecular Species: NEUTRALHBA: 2HBD: 1
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 4.16CX LogD: 4.16
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.23Np Likeness Score: -0.64

References

1. Ramström H, Bourotte M, Philippe C, Schmitt M, Haiech J, Bourguignon JJ..  (2004)  Heterocyclic bis-cations as starting hits for design of inhibitors of the bifunctional enzyme histidine-containing protein kinase/phosphatase from Bacillus subtilis.,  47  (9): [PMID:15084125] [10.1021/jm021043o]

Source