2-Amino-1-dodecyl-3-(4-methyl-benzyl)-3H-benzoimidazol-1-ium

ID: ALA3559474

PubChem CID: 118753796

Max Phase: Preclinical

Molecular Formula: C29H41N3O4

Molecular Weight: 406.64

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCCCCCCC[n+]1c(N)n(Cc2ccc(C)cc2)c2ccccc21.O=C([O-])C(=O)O

Standard InChI:  InChI=1S/C27H39N3.C2H2O4/c1-3-4-5-6-7-8-9-10-11-14-21-29-25-15-12-13-16-26(25)30(27(29)28)22-24-19-17-23(2)18-20-24;3-1(4)2(5)6/h12-13,15-20,28H,3-11,14,21-22H2,1-2H3;(H,3,4)(H,5,6)

Standard InChI Key:  MEMUTEKDTWBCLC-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 37  0  0  0  0  0  0  0  0999 V2000
    0.6270   -6.5835    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1343   -6.8872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6585   -6.2465    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.5854   -5.7639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2092   -5.5518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4822   -6.2881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3340   -7.6860    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3259   -7.0370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9315   -5.6017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8302   -4.2163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1637   -5.1774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4256   -4.7530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7553   -5.6474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5571   -4.8653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0064   -4.1747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2046   -4.9527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2795   -3.5257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0706   -6.6584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4732   -7.4738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7910   -7.0120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9329   -6.8206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1923   -7.1868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4976   -6.7374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7612   -7.1119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0504   -7.3740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3640   -6.9122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6193   -7.2741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9515   -4.3911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1527   -4.1747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2138   -7.1202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6568   -2.9063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3698   -3.3191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9438   -3.3191    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0828   -2.9063    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6568   -2.0765    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3698   -4.1447    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  1  1  0
  5  4  2  0
  6  3  1  0
  7  2  1  0
  8  1  1  0
  9  6  1  0
 10 15  2  0
 11  4  1  0
 12  5  1  0
 13  9  1  0
 14  9  2  0
 15 14  1  0
 16 13  2  0
 17 10  1  0
 18  8  1  0
 19 20  1  0
 20 25  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 18  1  0
 25 26  1  0
 26 27  1  0
 27 21  1  0
 28 11  2  0
 29 28  1  0
 30 19  1  0
  3  5  1  0
 12 29  2  0
 16 10  1  0
 32 31  1  0
 33 31  1  0
 34 32  1  0
 35 31  2  0
 36 32  2  0
M  CHG  2   1   1  33  -1
M  END

Associated Targets(non-human)

hprK HPr kinase (97 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 406.64Molecular Weight (Monoisotopic): 406.3217AlogP: 6.79#Rotatable Bonds: 13
Polar Surface Area: 34.83Molecular Species: NEUTRALHBA: 2HBD: 1
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 4.07CX LogD: 4.07
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.25Np Likeness Score: -0.54

References

1. Ramström H, Bourotte M, Philippe C, Schmitt M, Haiech J, Bourguignon JJ..  (2004)  Heterocyclic bis-cations as starting hits for design of inhibitors of the bifunctional enzyme histidine-containing protein kinase/phosphatase from Bacillus subtilis.,  47  (9): [PMID:15084125] [10.1021/jm021043o]

Source