The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID173028063 ID: ALA3561387
PubChem CID: 73058518
Max Phase: Preclinical
Molecular Formula: C23H23F2NO3S
Molecular Weight: 431.50
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(CSCC(=O)c2cc(C)n(-c3ccc(OC(F)F)cc3)c2C)cc1
Standard InChI: InChI=1S/C23H23F2NO3S/c1-15-12-21(22(27)14-30-13-17-4-8-19(28-3)9-5-17)16(2)26(15)18-6-10-20(11-7-18)29-23(24)25/h4-12,23H,13-14H2,1-3H3
Standard InChI Key: DPIIDSDHXSZGPU-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
1.8029 -0.2924 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-4.6185 3.7894 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-4.0537 2.8156 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.2814 0.0093 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.3513 3.8731 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9292 -3.3496 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.5351 2.2490 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.4616 1.4467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3329 1.2766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1975 2.5843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2391 2.6555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7403 1.9796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6634 0.5352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2391 3.4680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9428 2.2492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9479 1.0154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3299 3.2207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6464 3.4680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4719 0.4501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9428 3.8743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6464 2.6555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9425 -1.1200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0798 -1.9490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6012 -2.6057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6114 -0.3775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7504 -1.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4639 -1.7766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7932 -2.5195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0548 3.4656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5455 -3.8743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 19 1 0
1 25 1 0
2 29 1 0
3 29 1 0
4 13 2 0
5 18 1 0
5 29 1 0
6 24 1 0
6 30 1 0
7 8 1 0
7 10 1 0
7 11 1 0
8 9 2 0
8 16 1 0
9 12 1 0
9 13 1 0
10 12 2 0
10 17 1 0
11 14 2 0
11 15 1 0
13 19 1 0
14 20 1 0
15 21 2 0
18 20 2 0
18 21 1 0
22 25 1 0
22 26 2 0
22 27 1 0
23 24 2 0
23 26 1 0
24 28 1 0
27 28 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 431.50Molecular Weight (Monoisotopic): 431.1367AlogP: 5.82#Rotatable Bonds: 9Polar Surface Area: 40.46Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.74CX LogD: 5.74Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.40Np Likeness Score: -1.93
References 1. PubChem BioAssay data set,