1-Phenyl-8-(1-phenyl-1H-pyrrol-3-ylmethyl)-1,3,8-triaza-spiro[4.5]decan-4-one

ID: ALA356542

PubChem CID: 10572229

Max Phase: Preclinical

Molecular Formula: C24H26N4O

Molecular Weight: 386.50

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C1NCN(c2ccccc2)C12CCN(Cc1ccn(-c3ccccc3)c1)CC2

Standard InChI:  InChI=1S/C24H26N4O/c29-23-24(28(19-25-23)22-9-5-2-6-10-22)12-15-26(16-13-24)17-20-11-14-27(18-20)21-7-3-1-4-8-21/h1-11,14,18H,12-13,15-17,19H2,(H,25,29)

Standard InChI Key:  DZHKYKKLIHHVIU-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 33  0  0  0  0  0  0  0  0999 V2000
    6.0500   -2.9250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8542   -3.1042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.1792   -4.2542    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.9167   -0.8625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6292   -3.6375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9375   -3.9250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2167   -0.5792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6667   -1.1917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0000   -0.0417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2292   -2.8375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5375   -2.2542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3792   -1.4167    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8042    0.1333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4667   -2.5542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2042   -1.2792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0417   -0.6667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8125   -3.7167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8917   -2.0875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2542   -2.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3042   -1.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4917   -0.8667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2042   -2.1042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7792   -1.2792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8667   -2.2667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9167   -1.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4917   -2.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7792   -2.1042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7042   -1.4542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  5  1  0
  4  8  1  0
  5  1  1  0
  6  2  1  0
  7 16  1  0
  8  7  2  0
  9 13  2  0
 10  1  1  0
 11  1  1  0
 12 19  1  0
 13  7  1  0
 14  2  1  0
 15  4  1  0
 16 12  1  0
 17  5  2  0
 18 10  1  0
 19 11  1  0
 20 14  2  0
 21 14  1  0
 22 15  2  0
 23 15  1  0
 24 22  1  0
 25 20  1  0
 26 21  2  0
 27 23  2  0
 28 27  1  0
 29 26  1  0
 18 12  1  0
  6  3  1  0
 29 25  2  0
  4  9  1  0
 28 24  2  0
M  END

Associated Targets(Human)

DRD4 Tchem Dopamine D4 receptor (7907 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

DRD2 Dopamine D2 receptor (26 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
DRD3 Dopamine D3 receptor (16 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 386.50Molecular Weight (Monoisotopic): 386.2107AlogP: 3.41#Rotatable Bonds: 4
Polar Surface Area: 40.51Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 11.97CX Basic pKa: 8.27CX LogP: 3.86CX LogD: 2.93
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.75Np Likeness Score: -0.67

References

1. Thurkauf A, Yuan J, Chen X, Wasley JW, Meade R, Woodruff KH, Huston K, Ross PC..  (1995)  1-Phenyl-3-(aminomethyl)pyrroles as potential antipsychotic agents. Synthesis and dopamine receptor binding.,  38  (25): [PMID:8523409] [10.1021/jm00025a013]

Source