The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-Phenyl-8-(1-phenyl-1H-pyrrol-3-ylmethyl)-1,3,8-triaza-spiro[4.5]decan-4-one ID: ALA356542
PubChem CID: 10572229
Max Phase: Preclinical
Molecular Formula: C24H26N4O
Molecular Weight: 386.50
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C1NCN(c2ccccc2)C12CCN(Cc1ccn(-c3ccccc3)c1)CC2
Standard InChI: InChI=1S/C24H26N4O/c29-23-24(28(19-25-23)22-9-5-2-6-10-22)12-15-26(16-13-24)17-20-11-14-27(18-20)21-7-3-1-4-8-21/h1-11,14,18H,12-13,15-17,19H2,(H,25,29)
Standard InChI Key: DZHKYKKLIHHVIU-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 33 0 0 0 0 0 0 0 0999 V2000
6.0500 -2.9250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8542 -3.1042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1792 -4.2542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.9167 -0.8625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6292 -3.6375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9375 -3.9250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2167 -0.5792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6667 -1.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0000 -0.0417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2292 -2.8375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5375 -2.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3792 -1.4167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8042 0.1333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4667 -2.5542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2042 -1.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0417 -0.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8125 -3.7167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8917 -2.0875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2542 -2.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3042 -1.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4917 -0.8667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2042 -2.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7792 -1.2792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8667 -2.2667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9167 -1.2000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4917 -2.5167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7792 -2.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7042 -1.4542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 5 1 0
4 8 1 0
5 1 1 0
6 2 1 0
7 16 1 0
8 7 2 0
9 13 2 0
10 1 1 0
11 1 1 0
12 19 1 0
13 7 1 0
14 2 1 0
15 4 1 0
16 12 1 0
17 5 2 0
18 10 1 0
19 11 1 0
20 14 2 0
21 14 1 0
22 15 2 0
23 15 1 0
24 22 1 0
25 20 1 0
26 21 2 0
27 23 2 0
28 27 1 0
29 26 1 0
18 12 1 0
6 3 1 0
29 25 2 0
4 9 1 0
28 24 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 386.50Molecular Weight (Monoisotopic): 386.2107AlogP: 3.41#Rotatable Bonds: 4Polar Surface Area: 40.51Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.97CX Basic pKa: 8.27CX LogP: 3.86CX LogD: 2.93Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.75Np Likeness Score: -0.67
References 1. Thurkauf A, Yuan J, Chen X, Wasley JW, Meade R, Woodruff KH, Huston K, Ross PC.. (1995) 1-Phenyl-3-(aminomethyl)pyrroles as potential antipsychotic agents. Synthesis and dopamine receptor binding., 38 (25): [PMID:8523409 ] [10.1021/jm00025a013 ]