The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1,3-Diphenyl-2-thioxo-5-[5-(2-trifluoromethyl-phenyl)-furan-2-ylmethylene]-dihydro-pyrimidine-4,6-dione ID: ALA356815
PubChem CID: 44366849
Max Phase: Preclinical
Molecular Formula: C28H17F3N2O3S
Molecular Weight: 518.52
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C1C(=Cc2ccc(-c3ccccc3C(F)(F)F)o2)C(=O)N(c2ccccc2)C(=S)N1c1ccccc1
Standard InChI: InChI=1S/C28H17F3N2O3S/c29-28(30,31)23-14-8-7-13-21(23)24-16-15-20(36-24)17-22-25(34)32(18-9-3-1-4-10-18)27(37)33(26(22)35)19-11-5-2-6-12-19/h1-17H
Standard InChI Key: UFXYRSPYQFQWFE-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
7.3500 -0.3375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9167 0.1625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5292 0.4708 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.9625 -0.8917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3125 0.7208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7542 -0.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9792 -1.2917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7042 0.4208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5500 -1.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2292 -0.9542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3167 -0.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1542 -2.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9375 -2.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5375 -0.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5667 -0.5875 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
6.9417 1.0583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7417 -1.6875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1250 0.0375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4875 1.5250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3625 -1.1917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.1042 -1.2875 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
13.4042 -1.9167 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.5042 -0.9292 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.1042 -3.1500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5375 -2.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1542 1.8625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1417 0.8375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9417 -1.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3167 -2.2667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7042 -3.4500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4917 -3.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5500 1.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7250 -2.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1000 -3.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5667 2.4583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7625 2.2333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3042 -3.2667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 6 1 0
3 1 1 0
4 1 1 0
5 3 1 0
6 4 1 0
7 10 1 0
8 2 2 0
9 13 1 0
10 11 1 0
11 8 1 0
12 7 1 0
13 12 1 0
14 18 1 0
15 1 2 0
16 3 1 0
17 4 1 0
18 11 2 0
19 5 2 0
20 6 2 0
21 9 1 0
22 9 1 0
23 9 1 0
24 13 2 0
25 12 2 0
26 16 2 0
27 16 1 0
28 17 2 0
29 17 1 0
30 25 1 0
31 30 2 0
32 27 2 0
33 28 1 0
34 29 2 0
35 26 1 0
36 32 1 0
37 34 1 0
5 2 1 0
37 33 2 0
36 35 2 0
14 7 2 0
24 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 518.52Molecular Weight (Monoisotopic): 518.0912AlogP: 6.71#Rotatable Bonds: 4Polar Surface Area: 53.76Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 6.94CX LogD: 6.94Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.17Np Likeness Score: -1.09
References 1. Voss ME, Carter PH, Tebben AJ, Scherle PA, Brown GD, Thompson LA, Xu M, Lo YC, Yang G, Liu RQ, Strzemienski P, Everlof JG, Trzaskos JM, Decicco CP.. (2003) Both 5-arylidene-2-thioxodihydropyrimidine-4,6(1H,5H)-diones and 3-thioxo-2,3-dihydro-1H-imidazo[1,5-a]indol-1-ones are light-dependent tumor necrosis factor-alpha antagonists., 13 (3): [PMID:12565966 ] [10.1016/s0960-894x(02)00941-1 ]