3-[5-(4,6-Dioxo-1,3-diphenyl-2-thioxo-tetrahydro-pyrimidin-5-ylidenemethyl)-furan-2-yl]-thiophene-2-carboxylic acid methyl ester

ID: ALA357328

PubChem CID: 44367073

Max Phase: Preclinical

Molecular Formula: C27H18N2O5S2

Molecular Weight: 514.58

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  COC(=O)c1sccc1-c1ccc(C=C2C(=O)N(c3ccccc3)C(=S)N(c3ccccc3)C2=O)o1

Standard InChI:  InChI=1S/C27H18N2O5S2/c1-33-26(32)23-20(14-15-36-23)22-13-12-19(34-22)16-21-24(30)28(17-8-4-2-5-9-17)27(35)29(25(21)31)18-10-6-3-7-11-18/h2-16H,1H3

Standard InChI Key:  YOLLAYRIPHPDMG-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
    7.9417   -0.2125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5125    0.2875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1167    0.5958    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.5542   -0.7667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.9042    0.8458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3417   -0.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7417   -1.9667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4917   -2.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5750   -1.1667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3000    0.5458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8167   -0.8292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9042   -0.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2042   -1.8792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1292   -0.5542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4125   -3.1167    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.1542   -0.4625    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.5292    1.1833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3375   -1.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7167    0.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0792    1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.9542   -1.0667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.2000   -2.5750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6042   -3.2875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2042   -1.0542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.9250   -2.2917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7500    1.9875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7292    0.9625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5375   -1.7625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9042   -2.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6375   -1.8792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1417    1.5500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3167   -2.5542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6917   -2.9292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1625    2.5833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3542    2.3583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8917   -3.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  6  1  0
  3  1  1  0
  4  1  1  0
  5  3  1  0
  6  4  1  0
  7  9  1  0
  8  7  2  0
  9 11  1  0
 10  2  2  0
 11 12  1  0
 12 10  1  0
 13  8  1  0
 14 19  1  0
 15  8  1  0
 16  1  2  0
 17  3  1  0
 18  4  1  0
 19 12  2  0
 20  5  2  0
 21  6  2  0
 22  7  1  0
 23 22  2  0
 24 13  2  0
 25 13  1  0
 26 17  2  0
 27 17  1  0
 28 18  2  0
 29 18  1  0
 30 25  1  0
 31 27  2  0
 32 28  1  0
 33 29  2  0
 34 26  1  0
 35 31  1  0
 36 33  1  0
  5  2  1  0
 36 32  2  0
 35 34  2  0
 14  9  2  0
 15 23  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA357328

   3-[5-(4,6-Dioxo-1,3-diphenyl-2-thioxo-tetrahydro-pyrimidin-5-ylidenemethyl)-furan-2-yl]-thiophene-2-carboxylic acid methyl ester

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 514.58

Molecular Weight (Monoisotopic): 514.0657

AlogP: 5.54

#Rotatable Bonds: 5

Polar Surface Area: 80.06

Molecular Species: NEUTRAL

HBA: 7

HBD: ┄

#RO5 Violations: 2

HBA (Lipinski): 7

HBD (Lipinski): ┄

#RO5 Violations (Lipinski): 2

CX Acidic pKa: ┄

CX Basic pKa: ┄

CX LogP: 5.98

CX LogD: 5.98

Aromatic Rings: 4

Heavy Atoms: 36

QED Weighted: 0.15

Np Likeness Score: -1.21

References

1. Voss ME, Carter PH, Tebben AJ, Scherle PA, Brown GD, Thompson LA, Xu M, Lo YC, Yang G, Liu RQ, Strzemienski P, Everlof JG, Trzaskos JM, Decicco CP..  (2003)  Both 5-arylidene-2-thioxodihydropyrimidine-4,6(1H,5H)-diones and 3-thioxo-2,3-dihydro-1H-imidazo[1,5-a]indol-1-ones are light-dependent tumor necrosis factor-alpha antagonists.,  13  (3): [PMID:12565966] [10.1016/s0960-894x(02)00941-1]

Source

Source(1):

• Scientific Literature