The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4beta-(1-Carbomethoxypentyl-4-methyl-1,2,3-triazolyl)-4'-demethylepipodophyllotoxin ID: ALA3576957
PubChem CID: 122177354
Max Phase: Preclinical
Molecular Formula: C31H35N3O10
Molecular Weight: 609.63
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)CCCCCn1cc(CO[C@@H]2c3cc4c(cc3[C@@H](c3cc(OC)c(O)c(OC)c3)[C@H]3C(=O)OC[C@@H]32)OCO4)nn1
Standard InChI: InChI=1S/C31H35N3O10/c1-38-24-9-17(10-25(39-2)29(24)36)27-19-11-22-23(44-16-43-22)12-20(19)30(21-15-42-31(37)28(21)27)41-14-18-13-34(33-32-18)8-6-4-5-7-26(35)40-3/h9-13,21,27-28,30,36H,4-8,14-16H2,1-3H3/t21-,27+,28-,30+/m0/s1
Standard InChI Key: DRUSJMFFCAPGHU-WMVTVRAXSA-N
Molfile:
RDKit 2D
46 51 0 0 0 0 0 0 0 0999 V2000
1.2953 1.4998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2953 -1.4862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2953 1.4998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2953 -1.4862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6043 0.7226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6043 -0.7090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0359 -1.2135 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9222 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0359 1.2135 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6043 -0.7090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6043 0.7226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0359 1.2135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9222 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.0359 -1.2135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3961 2.3582 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2919 3.0006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5796 3.7685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5583 5.2684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2488 5.9999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0395 5.2315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0182 3.7317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8489 6.0345 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.8957 5.4478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3513 5.9607 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3810 5.3446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2317 7.1998 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.7026 -1.7042 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.7068 1.7174 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.2857 -2.9865 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0183 -3.7293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0280 -5.2301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2452 -6.0846 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7879 -7.5132 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7120 -7.5198 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.1818 -6.0953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5899 -8.7339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0830 -8.5814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9623 -9.7976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4554 -9.6451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.3348 -10.8614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8278 -10.7088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.7072 -11.9251 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-8.3188 -9.6139 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-9.9010 -11.8031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7 1 1 0
1 4 2 0
3 2 2 0
2 8 1 0
3 4 1 0
3 6 1 0
4 5 1 0
5 13 1 0
12 6 1 0
7 8 2 0
8 9 1 0
9 10 1 0
10 11 1 0
11 7 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
12 16 1 0
14 17 2 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
5 18 1 6
24 25 1 0
20 24 1 0
26 27 1 0
22 26 1 0
21 28 1 0
12 29 1 6
13 30 1 1
6 31 1 1
31 32 1 0
32 33 1 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 1 0
37 33 2 0
36 38 1 0
38 39 1 0
39 40 1 0
40 41 1 0
41 42 1 0
42 43 1 0
43 44 1 0
43 45 2 0
44 46 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 609.63Molecular Weight (Monoisotopic): 609.2322AlogP: 3.66#Rotatable Bonds: 12Polar Surface Area: 149.69Molecular Species: NEUTRALHBA: 13HBD: 1#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.33CX Basic pKa: ┄CX LogP: 3.01CX LogD: 3.01Aromatic Rings: 3Heavy Atoms: 44QED Weighted: 0.24Np Likeness Score: 0.60
References 1. Mariani A, Bartoli A, Atwal M, Lee KC, Austin CA, Rodriguez R.. (2015) Differential Targeting of Human Topoisomerase II Isoforms with Small Molecules., 58 (11): [PMID:25945730 ] [10.1021/acs.jmedchem.5b00473 ]