(S)-methyl 2-(2-(2-acetamidophenyl)-2-oxoacetamido)-4-methylpentanoate

ID: ALA3577035

PubChem CID: 122177418

Max Phase: Preclinical

Molecular Formula: C17H22N2O5

Molecular Weight: 334.37

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COC(=O)[C@H](CC(C)C)NC(=O)C(=O)c1ccccc1NC(C)=O

Standard InChI:  InChI=1S/C17H22N2O5/c1-10(2)9-14(17(23)24-4)19-16(22)15(21)12-7-5-6-8-13(12)18-11(3)20/h5-8,10,14H,9H2,1-4H3,(H,18,20)(H,19,22)/t14-/m0/s1

Standard InChI Key:  AQXUUUJZLZKMQT-AWEZNQCLSA-N

Molfile:  

     RDKit          2D

 24 24  0  0  0  0  0  0  0  0999 V2000
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5973    1.5031    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5972   -1.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5951   -3.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6375   -0.9049    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5548   -3.6021    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8933   -3.7570    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8912   -5.2578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1894   -6.0109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5916   -6.0087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5912   -7.5095    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5524   -5.4087    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1872   -7.5117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2252   -8.1139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1469   -8.1099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5521   -8.1098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5951    3.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6331    3.6060    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5549    3.6021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  5  8  1  0
  8  9  1  0
  8 10  2  0
  9 11  2  0
  9 12  1  0
 12 13  1  0
 13 14  1  6
 13 15  1  0
 15 16  1  0
 15 17  2  0
 14 18  1  0
 18 19  1  0
 18 20  1  0
 16 21  1  0
  7 22  1  0
 22 23  2  0
 22 24  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3577035

    ---

Associated Targets(non-human)

MAOB Monoamine oxidase B (894 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Maoa Monoamine oxidase A (2058 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 334.37Molecular Weight (Monoisotopic): 334.1529AlogP: 1.53#Rotatable Bonds: 7
Polar Surface Area: 101.57Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 11.46CX Basic pKa: CX LogP: 2.24CX LogD: 2.24
Aromatic Rings: 1Heavy Atoms: 24QED Weighted: 0.45Np Likeness Score: -0.55

References

1. El-Faham A, Zainab Al Marhoon, Abdel-Megeed A, Khattab SN, Bekhit AA, Albericio F..  (2014)  α-Ketoamino acid ester derivatives as promising MAO inhibitors.,  25  (1): [PMID:25466194] [10.1016/j.bmcl.2014.11.007]

Source