The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-dimethyl 2-(2-(2-acetamidophenyl)-2-oxoacetamido)succinate ID: ALA3577036
PubChem CID: 101537371
Max Phase: Preclinical
Molecular Formula: C16H18N2O7
Molecular Weight: 350.33
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)C[C@H](NC(=O)C(=O)c1ccccc1NC(C)=O)C(=O)OC
Standard InChI: InChI=1S/C16H18N2O7/c1-9(19)17-11-7-5-4-6-10(11)14(21)15(22)18-12(16(23)25-3)8-13(20)24-2/h4-7,12H,8H2,1-3H3,(H,17,19)(H,18,22)/t12-/m0/s1
Standard InChI Key: MGPQVZXDXKBJGP-LBPRGKRZSA-N
Molfile:
RDKit 2D
25 25 0 0 0 0 0 0 0 0999 V2000
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5973 1.5031 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5972 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6375 -0.9049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.5548 -3.6021 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8933 -3.7570 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8912 -5.2578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1894 -6.0109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5916 -6.0087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5912 -7.5095 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.5524 -5.4087 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.5521 -8.1098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1872 -7.5117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4854 -8.2648 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.1469 -8.1099 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.4837 -9.4648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5951 3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6331 3.6060 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.5549 3.6021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
4 7 1 0
5 8 1 0
8 9 1 0
8 10 2 0
9 11 2 0
9 12 1 0
12 13 1 0
13 14 1 6
13 15 1 0
15 16 1 0
15 17 2 0
16 18 1 0
14 19 1 0
19 20 1 0
19 21 2 0
20 22 1 0
7 23 1 0
23 24 2 0
23 25 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 350.33Molecular Weight (Monoisotopic): 350.1114AlogP: 0.05#Rotatable Bonds: 7Polar Surface Area: 127.87Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.13CX Basic pKa: ┄CX LogP: 0.49CX LogD: 0.49Aromatic Rings: 1Heavy Atoms: 25QED Weighted: 0.40Np Likeness Score: -0.48
References 1. El-Faham A, Zainab Al Marhoon, Abdel-Megeed A, Khattab SN, Bekhit AA, Albericio F.. (2014) α-Ketoamino acid ester derivatives as promising MAO inhibitors., 25 (1): [PMID:25466194 ] [10.1016/j.bmcl.2014.11.007 ]