The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
dehydroechinulin ID: ALA3577258
PubChem CID: 122177586
Max Phase: Preclinical
Molecular Formula: C34H45N3O2
Molecular Weight: 527.75
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(C)(C)c1[nH]c2c(CC=C(C)C)cc(CC=C(C)C)c(CC=C(C)C)c2c1/C=C1\NC(=O)[C@H](C)NC1=O
Standard InChI: InChI=1S/C34H45N3O2/c1-11-34(9,10)31-27(19-28-33(39)35-23(8)32(38)36-28)29-26(17-14-22(6)7)24(15-12-20(2)3)18-25(30(29)37-31)16-13-21(4)5/h11-14,18-19,23,37H,1,15-17H2,2-10H3,(H,35,39)(H,36,38)/b28-19-/t23-/m0/s1
Standard InChI Key: VFKFPZJHUBATFI-QYSZHFNSSA-N
Molfile:
RDKit 2D
39 41 0 0 0 0 0 0 0 0999 V2000
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1812 2.6271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6500 2.9355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6488 1.8163 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1174 2.1217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5873 3.5462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5886 4.6654 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1200 4.3600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3211 5.2554 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9164 1.2263 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7622 3.7904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0872 0.0351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8532 -1.2555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6750 1.0813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2871 0.0494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0531 -1.2418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9971 -3.0138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2935 -3.7700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2878 -5.2708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3243 -5.8754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2461 -5.8665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9971 3.0138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2935 3.7700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2878 5.2708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3243 5.8754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2461 5.8665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6217 1.4865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9153 0.7255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2216 1.4644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.2559 0.8558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2318 2.6643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 1 1 0
1 6 2 0
5 4 2 0
4 2 1 0
5 6 1 0
6 7 1 0
7 8 1 0
9 5 1 0
8 9 2 0
9 10 1 0
11 10 2 0
11 12 1 0
11 16 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 2 0
13 18 2 0
14 19 1 1
8 20 1 0
20 21 1 0
20 22 1 0
20 23 1 0
21 24 2 0
1 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
27 29 1 0
4 30 1 0
30 31 1 0
31 32 2 0
32 33 1 0
32 34 1 0
2 35 1 0
35 36 1 0
36 37 2 0
37 38 1 0
37 39 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 527.75Molecular Weight (Monoisotopic): 527.3512AlogP: 7.13#Rotatable Bonds: 9Polar Surface Area: 73.99Molecular Species: NEUTRALHBA: 2HBD: 3#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.52CX Basic pKa: ┄CX LogP: 7.38CX LogD: 7.38Aromatic Rings: 2Heavy Atoms: 39QED Weighted: 0.24Np Likeness Score: 1.68
References 1. Meng LH, Du FY, Li XM, Pedpradab P, Xu GM, Wang BG.. (2015) Rubrumazines A-C, Indolediketopiperazines of the Isoechinulin Class from Eurotium rubrum MA-150, a Fungus Obtained from Marine Mangrove-Derived Rhizospheric Soil., 78 (4): [PMID:25730346 ] [10.1021/np5007839 ]