dehydroechinulin

ID: ALA3577258

PubChem CID: 122177586

Max Phase: Preclinical

Molecular Formula: C34H45N3O2

Molecular Weight: 527.75

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=CC(C)(C)c1[nH]c2c(CC=C(C)C)cc(CC=C(C)C)c(CC=C(C)C)c2c1/C=C1\NC(=O)[C@H](C)NC1=O

Standard InChI:  InChI=1S/C34H45N3O2/c1-11-34(9,10)31-27(19-28-33(39)35-23(8)32(38)36-28)29-26(17-14-22(6)7)24(15-12-20(2)3)18-25(30(29)37-31)16-13-21(4)5/h11-14,18-19,23,37H,1,15-17H2,2-10H3,(H,35,39)(H,36,38)/b28-19-/t23-/m0/s1

Standard InChI Key:  VFKFPZJHUBATFI-QYSZHFNSSA-N

Molfile:  

     RDKit          2D

 39 41  0  0  0  0  0  0  0  0999 V2000
   -1.0028   -1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028    1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138   -1.2033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5889    0.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138    1.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1812    2.6271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6500    2.9355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6488    1.8163    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.1174    2.1217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5873    3.5462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5886    4.6654    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.1200    4.3600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3211    5.2554    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.9164    1.2263    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7622    3.7904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0872    0.0351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8532   -1.2555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6750    1.0813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2871    0.0494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0531   -1.2418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9971   -3.0138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2935   -3.7700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2878   -5.2708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3243   -5.8754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2461   -5.8665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9971    3.0138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2935    3.7700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2878    5.2708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3243    5.8754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2461    5.8665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6217    1.4865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9153    0.7255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2216    1.4644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2559    0.8558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2318    2.6643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  1  1  0
  1  6  2  0
  5  4  2  0
  4  2  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  9  5  1  0
  8  9  2  0
  9 10  1  0
 11 10  2  0
 11 12  1  0
 11 16  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 13 18  2  0
 14 19  1  1
  8 20  1  0
 20 21  1  0
 20 22  1  0
 20 23  1  0
 21 24  2  0
  1 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 27 29  1  0
  4 30  1  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 32 34  1  0
  2 35  1  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 37 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3577258

    ---

Associated Targets(non-human)

Artemia salina (1320 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 527.75Molecular Weight (Monoisotopic): 527.3512AlogP: 7.13#Rotatable Bonds: 9
Polar Surface Area: 73.99Molecular Species: NEUTRALHBA: 2HBD: 3
#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.52CX Basic pKa: CX LogP: 7.38CX LogD: 7.38
Aromatic Rings: 2Heavy Atoms: 39QED Weighted: 0.24Np Likeness Score: 1.68

References

1. Meng LH, Du FY, Li XM, Pedpradab P, Xu GM, Wang BG..  (2015)  Rubrumazines A-C, Indolediketopiperazines of the Isoechinulin Class from Eurotium rubrum MA-150, a Fungus Obtained from Marine Mangrove-Derived Rhizospheric Soil.,  78  (4): [PMID:25730346] [10.1021/np5007839]

Source