The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-{(4-Chlorobenzyl)[2-(diethylamino)ethyl]amino}-2-oxo-2H-chromene-3-carboximidamide Dihydrochloride ID: ALA3577295
PubChem CID: 122177619
Max Phase: Preclinical
Molecular Formula: C23H28Cl2N4O2
Molecular Weight: 426.95
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCN(CC)CCN(Cc1ccc(Cl)cc1)c1ccc2cc(C(=N)N)c(=O)oc2c1.Cl
Standard InChI: InChI=1S/C23H27ClN4O2.ClH/c1-3-27(4-2)11-12-28(15-16-5-8-18(24)9-6-16)19-10-7-17-13-20(22(25)26)23(29)30-21(17)14-19;/h5-10,13-14H,3-4,11-12,15H2,1-2H3,(H3,25,26);1H
Standard InChI Key: DECKBXVEUXDZOQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 32 0 0 0 0 0 0 0 0999 V2000
7.6921 -2.2543 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6321 -1.3486 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8911 1.5017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9314 0.9035 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8894 2.7017 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.9085 -1.5030 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.9066 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2049 -3.7567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2109 -0.7572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5084 -1.5115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8113 -0.7681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.1066 -1.5245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0991 -3.0245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7963 -3.7680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5010 -3.0116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2030 -5.2576 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.5013 -6.0104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4998 -7.2104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9036 -6.0086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9034 -7.2086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.1353 -3.6297 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 7 2 0
6 5 2 0
5 2 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 6 1 0
9 12 2 0
13 14 1 0
13 15 2 0
10 13 1 0
3 16 1 0
16 17 1 0
17 18 1 0
16 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
18 26 1 0
26 27 1 0
27 28 1 0
26 29 1 0
29 30 1 0
23 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 426.95Molecular Weight (Monoisotopic): 426.1823AlogP: 4.08#Rotatable Bonds: 9Polar Surface Area: 86.56Molecular Species: BASEHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.48CX LogP: 3.80CX LogD: 0.62Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.31Np Likeness Score: -0.86
References 1. Buta A, Maximyuk O, Kovalskyy D, Sukach V, Vovk M, Ievglevskyi O, Isaeva E, Isaev D, Savotchenko A, Krishtal O.. (2015) Novel Potent Orthosteric Antagonist of ASIC1a Prevents NMDAR-Dependent LTP Induction., 58 (11): [PMID:25974655 ] [10.1021/jm5017329 ]