The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-{(4-Chlorobenzyl)[2-(diethylamino)ethyl]amino}-2-oxo-2H-chromene-3-carboximidamide ID: ALA3577296
PubChem CID: 122177620
Product Number: C609322, Order Now?
Max Phase: Preclinical
Molecular Formula: C23H27ClN4O2
Molecular Weight: 426.95
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCN(CC)CCN(Cc1ccc(Cl)cc1)c1ccc2cc(C(=N)N)c(=O)oc2c1
Standard InChI: InChI=1S/C23H27ClN4O2/c1-3-27(4-2)11-12-28(15-16-5-8-18(24)9-6-16)19-10-7-17-13-20(22(25)26)23(29)30-21(17)14-19/h5-10,13-14H,3-4,11-12,15H2,1-2H3,(H3,25,26)
Standard InChI Key: VVYLUODGYRRACW-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6321 -1.3486 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8911 1.5017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9314 0.9035 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8894 2.7017 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.9085 -1.5030 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.9066 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2049 -3.7567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2109 -0.7572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5084 -1.5115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8113 -0.7681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.1066 -1.5245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0991 -3.0245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7963 -3.7680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5010 -3.0116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2030 -5.2576 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.5013 -6.0104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4998 -7.2104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9036 -6.0086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9034 -7.2086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.1353 -3.6297 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 5 1 0
8 11 2 0
12 13 1 0
12 14 2 0
9 12 1 0
2 15 1 0
15 16 1 0
16 17 1 0
15 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
17 25 1 0
25 26 1 0
26 27 1 0
25 28 1 0
28 29 1 0
22 30 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 426.95Molecular Weight (Monoisotopic): 426.1823AlogP: 4.08#Rotatable Bonds: 9Polar Surface Area: 86.56Molecular Species: BASEHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.48CX LogP: 3.80CX LogD: 0.62Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.31Np Likeness Score: -0.86
References 1. Buta A, Maximyuk O, Kovalskyy D, Sukach V, Vovk M, Ievglevskyi O, Isaeva E, Isaev D, Savotchenko A, Krishtal O.. (2015) Novel Potent Orthosteric Antagonist of ASIC1a Prevents NMDAR-Dependent LTP Induction., 58 (11): [PMID:25974655 ] [10.1021/jm5017329 ]