The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((S)-6-amino-1-(2-amino-N-(2-amino-2-oxoethyl)ethylsulfonamido)hexan-2-yl)-2-(N-((S)-2-amino-3-phenylpropyl)-1-phenylmethylsulfonamido)acetamide ID: ALA3577602
PubChem CID: 122177885
Max Phase: Preclinical
Molecular Formula: C28H45N7O6S2
Molecular Weight: 639.85
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: NCCCC[C@@H](CN(CC(N)=O)S(=O)(=O)CCN)NC(=O)CN(C[C@@H](N)Cc1ccccc1)S(=O)(=O)Cc1ccccc1
Standard InChI: InChI=1S/C28H45N7O6S2/c29-14-8-7-13-26(19-35(20-27(32)36)42(38,39)16-15-30)33-28(37)21-34(18-25(31)17-23-9-3-1-4-10-23)43(40,41)22-24-11-5-2-6-12-24/h1-6,9-12,25-26H,7-8,13-22,29-31H2,(H2,32,36)(H,33,37)/t25-,26-/m0/s1
Standard InChI Key: GSAFCXPFXFSFOB-UIOOFZCWSA-N
Molfile:
RDKit 2D
43 44 0 0 0 0 0 0 0 0999 V2000
9.1040 0.7323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7972 -1.5154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8045 -10.5145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7942 -6.0143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4990 -0.7623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0918 -3.7613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5955 -7.5241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5571 -8.1256 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.6688 -10.0116 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.0990 -0.7685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0929 -5.2621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1967 -3.0102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1954 -7.5196 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.7954 -7.5152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4957 -3.7618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8613 -0.1535 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1553 -6.9213 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4967 -8.2674 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1934 -6.3196 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5353 -3.1625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8967 -8.2719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7562 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
6.5024 -9.7682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1972 -1.5093 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.8090 -11.7145 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9019 0.4438 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7944 -2.7154 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4952 -5.2627 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3905 -3.0090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3893 -1.5082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2547 -1.0070 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.4039 1.4807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4059 2.9807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1078 3.7324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8078 2.9841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8059 1.4841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 10 1 6
8 7 1 0
29 2 1 0
26 24 1 0
18 13 1 0
4 14 1 0
12 15 1 0
20 13 2 0
5 26 1 0
14 18 1 0
15 30 1 0
11 6 1 0
2 5 1 0
16 24 2 0
22 7 1 0
23 19 1 0
10 1 1 0
4 11 1 1
24 23 1 0
3 9 1 0
18 25 1 0
15 21 2 0
3 27 2 0
13 17 2 0
26 12 1 0
25 3 1 0
30 4 1 0
24 28 2 0
13 22 1 0
19 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 19 1 0
6 36 1 0
36 37 1 0
37 38 1 0
1 39 2 0
39 40 1 0
40 41 2 0
41 42 1 0
42 43 2 0
43 1 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 639.85Molecular Weight (Monoisotopic): 639.2873AlogP: -0.92#Rotatable Bonds: 21Polar Surface Area: 225.01Molecular Species: BASEHBA: 9HBD: 5#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 9#RO5 Violations (Lipinski): 3CX Acidic pKa: ┄CX Basic pKa: 10.21CX LogP: -1.99CX LogD: -6.95Aromatic Rings: 2Heavy Atoms: 43QED Weighted: 0.11Np Likeness Score: -0.55