The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-[2-(4-Benzyl-piperazin-1-yl)-ethyl]-2-(4-dimethylamino-phenyl)-3H-quinazolin-4-one ID: ALA357996
PubChem CID: 44369247
Max Phase: Preclinical
Molecular Formula: C29H33N5O
Molecular Weight: 467.62
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)c1ccc(-c2nc3ccccc3c(=O)n2CCN2CCN(Cc3ccccc3)CC2)cc1
Standard InChI: InChI=1S/C29H33N5O/c1-31(2)25-14-12-24(13-15-25)28-30-27-11-7-6-10-26(27)29(35)34(28)21-20-32-16-18-33(19-17-32)22-23-8-4-3-5-9-23/h3-15H,16-22H2,1-2H3
Standard InChI Key: FYNPNAQICGVBPO-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
5.3042 -7.6292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3042 -8.4542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5875 -7.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5917 -8.8750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8792 -7.6375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8792 -8.4625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0167 -7.2125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0250 -8.8667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8667 -6.3667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4417 -7.2000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5792 -6.3917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4417 -9.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1542 -10.1125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.7292 -7.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0167 -9.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7375 -8.4417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7292 -10.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4417 -8.8667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5792 -5.9542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1500 -5.9542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8667 -7.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4292 -6.3750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1542 -7.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1625 -7.2250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2917 -6.3625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1625 -8.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1542 -10.9375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8750 -9.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2917 -7.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0000 -5.9417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4417 -7.6375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4417 -8.4667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7167 -6.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0042 -7.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7250 -7.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 1 0
4 2 2 0
5 3 1 0
6 5 1 0
7 1 1 0
8 2 1 0
9 21 1 0
10 14 1 0
11 3 2 0
12 18 1 0
13 12 1 0
14 7 1 0
15 8 2 0
16 8 1 0
17 15 1 0
18 16 2 0
19 9 1 0
20 22 1 0
21 23 1 0
22 10 1 0
23 10 1 0
24 5 2 0
25 19 1 0
26 6 2 0
27 13 1 0
28 13 1 0
29 25 2 0
30 25 1 0
31 24 1 0
32 31 2 0
33 30 2 0
34 29 1 0
35 33 1 0
4 6 1 0
17 12 2 0
20 9 1 0
32 26 1 0
34 35 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 467.62Molecular Weight (Monoisotopic): 467.2685AlogP: 3.95#Rotatable Bonds: 7Polar Surface Area: 44.61Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.73CX LogP: 4.55CX LogD: 4.05Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.41Np Likeness Score: -1.33
References 1. Wang S, Ryder H, Pretswell I, Depledge P, Milton J, Hancox TC, Dale I, Dangerfield W, Charlton P, Faint R, Dodd R, Hassan S.. (2002) Studies on quinazolinones as dual inhibitors of Pgp and MRP1 in multidrug resistance., 12 (4): [PMID:11844674 ] [10.1016/s0960-894x(01)00804-6 ]