The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-[2-Methoxy-5-(3,4,5-trimethoxy-phenoxymethyl)-phenoxy]-propane-1,2-diol ID: ALA358037
PubChem CID: 44367323
Max Phase: Preclinical
Molecular Formula: C20H26O8
Molecular Weight: 394.42
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(COc2cc(OC)c(OC)c(OC)c2)cc1OCC(O)CO
Standard InChI: InChI=1S/C20H26O8/c1-23-16-6-5-13(7-17(16)28-12-14(22)10-21)11-27-15-8-18(24-2)20(26-4)19(9-15)25-3/h5-9,14,21-22H,10-12H2,1-4H3
Standard InChI Key: MGYHEJDITQIJLQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 29 0 0 0 0 0 0 0 0999 V2000
-2.7458 -0.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4583 -1.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4333 -0.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8333 -0.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8583 -1.1500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8500 -0.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5458 -0.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1625 -0.2000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1375 -1.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2500 -0.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9458 -0.6542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8167 -1.7542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0583 -1.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3458 -0.5792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7625 -0.2167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7833 -1.6375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.7125 0.4458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0792 0.2958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6583 -1.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2167 -1.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7375 -1.2625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7917 0.8208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9625 -0.2500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6792 0.2833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6333 -0.0500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5000 -2.1667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3125 0.4625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0167 -1.7917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 1 1 0
4 3 2 0
5 2 1 0
6 10 2 0
7 4 1 0
8 6 1 0
9 12 2 0
10 13 1 0
11 7 1 0
12 20 1 0
13 19 1 0
14 1 1 0
15 8 1 0
16 2 1 0
17 3 1 0
18 15 1 0
19 11 1 0
20 13 2 0
21 9 1 0
22 18 1 0
23 24 1 0
24 18 1 0
25 14 1 0
26 16 1 0
27 17 1 0
28 21 1 0
7 5 2 0
6 9 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 394.42Molecular Weight (Monoisotopic): 394.1628AlogP: 2.03#Rotatable Bonds: 11Polar Surface Area: 95.84Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.62CX Basic pKa: ┄CX LogP: 1.43CX LogD: 1.43Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.60Np Likeness Score: 0.17
References 1. Lawrence NJ, Rennison D, Woo M, McGown AT, Hadfield JA.. (2001) Antimitotic and cell growth inhibitory properties of combretastatin A-4-like ethers., 11 (1): [PMID:11140732 ] [10.1016/s0960-894x(00)00596-5 ] 2. Ducki S, Mackenzie G, Lawrence NJ, Snyder JP.. (2005) Quantitative structure-activity relationship (5D-QSAR) study of combretastatin-like analogues as inhibitors of tubulin assembly., 48 (2): [PMID:15658859 ] [10.1021/jm049444m ]