The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Methoxy-5-((5',6',7'-trimethoxy-4'-oxochroman-3'-yl)-methyl)phenyl 3-phenylpropanoate ID: ALA3581100
PubChem CID: 122178626
Max Phase: Preclinical
Molecular Formula: C29H30O8
Molecular Weight: 506.55
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(CC2COc3cc(OC)c(OC)c(OC)c3C2=O)cc1OC(=O)CCc1ccccc1
Standard InChI: InChI=1S/C29H30O8/c1-32-21-12-10-19(15-22(21)37-25(30)13-11-18-8-6-5-7-9-18)14-20-17-36-23-16-24(33-2)28(34-3)29(35-4)26(23)27(20)31/h5-10,12,15-16,20H,11,13-14,17H2,1-4H3
Standard InChI Key: QNEDZBSKSMSMIV-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9091 -1.5019 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9072 -2.7019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9091 1.5019 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9072 2.7019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2907 2.9981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.3272 3.6028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 2.6973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8942 1.4964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1929 0.7441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4946 1.4896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7910 0.7351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7858 -0.7649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4842 -1.5104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1877 -0.7559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0845 -1.5172 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4759 -3.0112 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1725 -3.7553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1642 -5.2561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1250 -0.9193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1364 -3.1499 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8608 -6.0001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8525 -7.5009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5509 -8.2465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5457 -9.7465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8421 -10.5010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1437 -9.7555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1490 -8.2556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 12 2 0
11 4 2 0
4 1 1 0
5 6 1 0
2 5 1 0
7 8 1 0
1 7 1 0
9 10 1 0
4 9 1 0
11 12 1 0
11 16 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 2 0
15 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
22 25 1 0
23 26 1 0
26 27 1 0
27 28 1 0
25 29 1 0
27 30 2 0
28 31 1 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 506.55Molecular Weight (Monoisotopic): 506.1941AlogP: 4.69#Rotatable Bonds: 10Polar Surface Area: 89.52Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.69CX LogD: 4.69Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.29Np Likeness Score: 0.80
References 1. Basavarajappa HD, Lee B, Lee H, Sulaiman RS, An H, Magaña C, Shadmand M, Vayl A, Rajashekhar G, Kim EY, Suh YG, Lee K, Seo SY, Corson TW.. (2015) Synthesis and Biological Evaluation of Novel Homoisoflavonoids for Retinal Neovascularization., 58 (12): [PMID:26035340 ] [10.1021/acs.jmedchem.5b00449 ]