The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Methoxy-5-((5',6',7'-trimethoxy-4'-oxochroman-3'-yl)-methyl)phenyl Diethylcarbamate ID: ALA3581101
PubChem CID: 122178627
Max Phase: Preclinical
Molecular Formula: C25H31NO8
Molecular Weight: 473.52
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCN(CC)C(=O)Oc1cc(CC2COc3cc(OC)c(OC)c(OC)c3C2=O)ccc1OC
Standard InChI: InChI=1S/C25H31NO8/c1-7-26(8-2)25(28)34-18-12-15(9-10-17(18)29-3)11-16-14-33-19-13-20(30-4)23(31-5)24(32-6)21(19)22(16)27/h9-10,12-13,16H,7-8,11,14H2,1-6H3
Standard InChI Key: JIECECDQYMNLJM-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9091 -1.5019 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9072 -2.7019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9091 1.5019 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9072 2.7019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2907 2.9981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.3272 3.6028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 2.6973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8942 1.4964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1929 0.7441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4946 1.4896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7910 0.7351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7858 -0.7649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4842 -1.5104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1877 -0.7559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0845 -1.5172 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4759 -3.0112 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1725 -3.7553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1250 -0.9193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1364 -3.1499 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1642 -5.2561 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8608 -6.0001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4585 -6.0159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4505 -7.2159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8542 -7.2001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 12 2 0
11 4 2 0
4 1 1 0
5 6 1 0
2 5 1 0
7 8 1 0
1 7 1 0
9 10 1 0
4 9 1 0
11 12 1 0
11 16 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 2 0
15 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
22 25 1 0
23 26 1 0
26 27 1 0
25 28 1 0
27 29 2 0
27 30 1 0
30 31 1 0
30 32 1 0
32 33 1 0
31 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 473.52Molecular Weight (Monoisotopic): 473.2050AlogP: 4.00#Rotatable Bonds: 9Polar Surface Area: 92.76Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.24CX LogD: 3.24Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.54Np Likeness Score: 0.65
References 1. Basavarajappa HD, Lee B, Lee H, Sulaiman RS, An H, Magaña C, Shadmand M, Vayl A, Rajashekhar G, Kim EY, Suh YG, Lee K, Seo SY, Corson TW.. (2015) Synthesis and Biological Evaluation of Novel Homoisoflavonoids for Retinal Neovascularization., 58 (12): [PMID:26035340 ] [10.1021/acs.jmedchem.5b00449 ]