The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Methoxy-5-((5',6',7'-trimethoxy-4'-oxochroman-3'-yl)-methyl)phenyl((benzyloxy)carbonyl)-L-phenylalaninate ID: ALA3581108
PubChem CID: 122178633
Max Phase: Preclinical
Molecular Formula: C37H37NO10
Molecular Weight: 655.70
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(CC2COc3cc(OC)c(OC)c(OC)c3C2=O)cc1OC(=O)[C@H](Cc1ccccc1)NC(=O)OCc1ccccc1
Standard InChI: InChI=1S/C37H37NO10/c1-42-28-16-15-25(17-26-22-46-30-20-31(43-2)34(44-3)35(45-4)32(30)33(26)39)19-29(28)48-36(40)27(18-23-11-7-5-8-12-23)38-37(41)47-21-24-13-9-6-10-14-24/h5-16,19-20,26-27H,17-18,21-22H2,1-4H3,(H,38,41)/t26?,27-/m0/s1
Standard InChI Key: QCJGKCLENVWFDK-GEVKEYJPSA-N
Molfile:
RDKit 2D
48 52 0 0 0 0 0 0 0 0999 V2000
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9091 -1.5019 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9072 -2.7019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9091 1.5019 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9072 2.7019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2907 2.9981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.3272 3.6028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 2.6973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8942 1.4964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1929 0.7441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4946 1.4896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7910 0.7351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7858 -0.7649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4842 -1.5104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1877 -0.7559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0845 -1.5172 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4759 -3.0112 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1725 -3.7553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1250 -0.9193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1364 -3.1499 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1642 -5.2561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4585 -6.0159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8608 -6.0001 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8525 -7.5009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5491 -8.2450 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8886 -8.1063 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5408 -9.7458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2374 -10.4899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7641 -5.2758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0588 -6.0333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3622 -5.2909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3710 -3.7910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0764 -3.0334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7730 -3.7757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2270 -11.9899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0772 -12.7308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3710 -11.9719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3607 -10.4719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0565 -9.7309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 12 2 0
11 4 2 0
4 1 1 0
5 6 1 0
2 5 1 0
7 8 1 0
1 7 1 0
9 10 1 0
4 9 1 0
11 12 1 0
11 16 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 2 0
15 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
22 25 1 0
23 26 1 0
26 27 1 0
25 28 1 0
27 29 2 0
27 30 1 0
30 31 1 0
30 32 1 6
32 33 1 0
33 34 1 0
33 35 2 0
34 36 1 0
36 37 1 0
31 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 42 1 0
42 43 2 0
43 38 1 0
37 44 2 0
44 45 1 0
45 46 2 0
46 47 1 0
47 48 2 0
48 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 655.70Molecular Weight (Monoisotopic): 655.2417AlogP: 5.60#Rotatable Bonds: 13Polar Surface Area: 127.85Molecular Species: NEUTRALHBA: 10HBD: 1#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 1#RO5 Violations (Lipinski): 3CX Acidic pKa: 12.99CX Basic pKa: ┄CX LogP: 5.87CX LogD: 5.87Aromatic Rings: 4Heavy Atoms: 48QED Weighted: 0.14Np Likeness Score: 0.48
References 1. Basavarajappa HD, Lee B, Lee H, Sulaiman RS, An H, Magaña C, Shadmand M, Vayl A, Rajashekhar G, Kim EY, Suh YG, Lee K, Seo SY, Corson TW.. (2015) Synthesis and Biological Evaluation of Novel Homoisoflavonoids for Retinal Neovascularization., 58 (12): [PMID:26035340 ] [10.1021/acs.jmedchem.5b00449 ]