The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Methoxy-5-((5',6',7'-trimethoxy-4'-oxochroman-3'-yl)-methyl)phenyl (butylcarbamoyl)-L-phenylalaninate ID: ALA3581110
PubChem CID: 122178635
Max Phase: Preclinical
Molecular Formula: C34H40N2O9
Molecular Weight: 620.70
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCCNC(=O)N[C@@H](Cc1ccccc1)C(=O)Oc1cc(CC2COc3cc(OC)c(OC)c(OC)c3C2=O)ccc1OC
Standard InChI: InChI=1S/C34H40N2O9/c1-6-7-15-35-34(39)36-24(17-21-11-9-8-10-12-21)33(38)45-26-18-22(13-14-25(26)40-2)16-23-20-44-27-19-28(41-3)31(42-4)32(43-5)29(27)30(23)37/h8-14,18-19,23-24H,6-7,15-17,20H2,1-5H3,(H2,35,36,39)/t23?,24-/m0/s1
Standard InChI Key: JRGXFRNSWBALTH-CGAIIQECSA-N
Molfile:
RDKit 2D
45 48 0 0 0 0 0 0 0 0999 V2000
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9091 -1.5019 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9072 -2.7019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9091 1.5019 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9072 2.7019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2907 2.9981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.3272 3.6028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 2.6973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8942 1.4964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1929 0.7441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4946 1.4896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7910 0.7351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7858 -0.7649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4842 -1.5104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1877 -0.7559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0845 -1.5172 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4759 -3.0112 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1725 -3.7553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1250 -0.9193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1364 -3.1499 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1643 -5.2562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8608 -6.0001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4617 -6.0107 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7642 -5.2652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7684 -4.0652 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8525 -7.5009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5509 -8.2465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5456 -9.7464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8420 -10.5010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1436 -9.7556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1489 -8.2556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0616 -6.0197 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.3642 -5.2743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6616 -6.0288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9642 -5.2833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0015 -5.8866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 12 2 0
11 4 2 0
4 1 1 0
5 6 1 0
2 5 1 0
7 8 1 0
1 7 1 0
9 10 1 0
4 9 1 0
11 12 1 0
11 16 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 2 0
15 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
22 25 1 0
23 26 1 0
26 27 1 0
25 28 1 0
27 29 2 0
27 30 1 0
30 31 1 0
30 32 1 1
32 33 1 0
33 34 2 0
31 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 35 1 0
33 41 1 0
41 42 1 0
42 43 1 0
43 44 1 0
44 45 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 620.70Molecular Weight (Monoisotopic): 620.2734AlogP: 4.77#Rotatable Bonds: 14Polar Surface Area: 130.65Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.74CX LogD: 4.74Aromatic Rings: 3Heavy Atoms: 45QED Weighted: 0.15Np Likeness Score: 0.33
References 1. Basavarajappa HD, Lee B, Lee H, Sulaiman RS, An H, Magaña C, Shadmand M, Vayl A, Rajashekhar G, Kim EY, Suh YG, Lee K, Seo SY, Corson TW.. (2015) Synthesis and Biological Evaluation of Novel Homoisoflavonoids for Retinal Neovascularization., 58 (12): [PMID:26035340 ] [10.1021/acs.jmedchem.5b00449 ]