The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
tert-Butyl ((2S)-3-(4''-(Allyloxy)phenyl)-1-((2-methoxy-5-((5',6',7'-trimethoxy-4'-oxochroman-3'-yl)methyl)phenyl)-amino)-1-oxopropan-2-yl)carbamate ID: ALA3581114
PubChem CID: 122178639
Max Phase: Preclinical
Molecular Formula: C37H44N2O10
Molecular Weight: 676.76
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C=CCOc1ccc(C[C@H](NC(=O)OC(C)(C)C)C(=O)Nc2cc(CC3COc4cc(OC)c(OC)c(OC)c4C3=O)ccc2OC)cc1
Standard InChI: InChI=1S/C37H44N2O10/c1-9-16-47-25-13-10-22(11-14-25)18-27(39-36(42)49-37(2,3)4)35(41)38-26-19-23(12-15-28(26)43-5)17-24-21-48-29-20-30(44-6)33(45-7)34(46-8)31(29)32(24)40/h9-15,19-20,24,27H,1,16-18,21H2,2-8H3,(H,38,41)(H,39,42)/t24?,27-/m0/s1
Standard InChI Key: LJIAHEODRJGOMW-WKDCXCOVSA-N
Molfile:
RDKit 2D
49 52 0 0 0 0 0 0 0 0999 V2000
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9091 -1.5019 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9072 -2.7019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9091 1.5019 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9072 2.7019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2907 2.9981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.3272 3.6028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 2.6973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8942 1.4964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1929 0.7441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4946 1.4896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7910 0.7351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7858 -0.7649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4842 -1.5104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1877 -0.7559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0845 -1.5172 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4759 -3.0112 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1725 -3.7553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1250 -0.9193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1364 -3.1499 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1642 -5.2561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8608 -6.0001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4616 -6.0106 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8525 -7.5009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5509 -8.2465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5457 -9.7465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8421 -10.5010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1437 -9.7555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1490 -8.2556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7642 -5.2651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7683 -4.0651 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0616 -6.0196 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3642 -5.2741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4015 -5.8773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3683 -4.0741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4054 -4.6775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8400 -12.0019 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1382 -12.7549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1360 -14.2558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1740 -14.8579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 12 2 0
11 4 2 0
4 1 1 0
5 6 1 0
2 5 1 0
7 8 1 0
1 7 1 0
9 10 1 0
4 9 1 0
11 12 1 0
11 16 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 2 0
15 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
22 25 1 0
23 26 1 0
26 27 1 0
25 28 1 0
27 29 2 0
27 30 1 0
30 31 1 0
30 32 1 1
31 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 33 1 0
32 39 1 0
39 40 2 0
39 41 1 0
41 42 1 0
42 43 1 0
42 44 1 0
42 45 1 0
36 46 1 0
46 47 1 0
47 48 1 0
48 49 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 676.76Molecular Weight (Monoisotopic): 676.2996AlogP: 5.79#Rotatable Bonds: 14Polar Surface Area: 139.88Molecular Species: NEUTRALHBA: 10HBD: 2#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 2#RO5 Violations (Lipinski): 3CX Acidic pKa: 11.84CX Basic pKa: ┄CX LogP: 5.41CX LogD: 5.41Aromatic Rings: 3Heavy Atoms: 49QED Weighted: 0.20Np Likeness Score: 0.22
References 1. Basavarajappa HD, Lee B, Lee H, Sulaiman RS, An H, Magaña C, Shadmand M, Vayl A, Rajashekhar G, Kim EY, Suh YG, Lee K, Seo SY, Corson TW.. (2015) Synthesis and Biological Evaluation of Novel Homoisoflavonoids for Retinal Neovascularization., 58 (12): [PMID:26035340 ] [10.1021/acs.jmedchem.5b00449 ]