The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
adametizine A ID: ALA3581167
PubChem CID: 101913793
Max Phase: Preclinical
Molecular Formula: C21H23ClN2O8S2
Molecular Weight: 531.01
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc([C@@H]2SS[C@@]34C[C@]5(O)[C@H](Cl)C=C[C@@H](O)[C@@H]5ON3C(=O)[C@@H]2N(C)C4=O)c(O)c1OC
Standard InChI: InChI=1S/C21H23ClN2O8S2/c1-23-13-16(9-4-6-11(30-2)15(31-3)14(9)26)33-34-21(19(23)28)8-20(29)12(22)7-5-10(25)17(20)32-24(21)18(13)27/h4-7,10,12-13,16-17,25-26,29H,8H2,1-3H3/t10-,12-,13-,16+,17+,20+,21-/m1/s1
Standard InChI Key: AWPMMJDFXQCEES-FEHKQZEWSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
7.1798 -0.1535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8187 -1.6094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3774 -2.0247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0995 0.8871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6581 0.4718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2971 -0.9841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8557 -1.3993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5778 1.5125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1364 1.0972 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.6852 -0.3846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3514 1.0778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2427 -0.5726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3515 1.0777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.7286 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.6852 -0.3847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6555 0.7264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1273 0.4368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1139 1.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6288 2.9860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1570 3.2756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1703 2.1457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6686 4.6947 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4909 4.9247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.6183 4.1145 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.7954 3.8811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9929 2.3774 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3884 2.0518 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8988 1.4424 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
4.0082 -2.1488 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7500 -1.5574 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-0.7500 -1.5574 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.1689 0.0945 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 2.9286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0885 -3.1894 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-0.4618 -1.7524 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2896 1.8259 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.9511 -1.3487 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
1 4 1 0
2 3 1 0
3 6 1 0
5 4 1 0
5 6 1 0
5 8 1 0
6 7 1 0
7 10 1 0
9 8 1 0
9 10 1 0
9 12 1 0
10 11 1 0
11 14 1 0
13 12 1 0
13 14 1 0
13 15 1 0
16 15 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
22 23 1 0
20 22 1 0
24 25 1 0
19 24 1 0
21 26 1 0
4 27 1 6
5 28 1 6
6 29 1 6
10 30 1 6
30 31 1 0
15 31 1 0
13 32 1 6
14 33 1 0
3 34 1 1
12 35 2 0
11 36 2 0
15 37 1 6
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 531.01Molecular Weight (Monoisotopic): 530.0584AlogP: 1.18#Rotatable Bonds: 3Polar Surface Area: 129.00Molecular Species: NEUTRALHBA: 10HBD: 3#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.71CX Basic pKa: ┄CX LogP: 1.30CX LogD: 1.29Aromatic Rings: 1Heavy Atoms: 34QED Weighted: 0.30Np Likeness Score: 1.53
References 1. Liu Y, Li XM, Meng LH, Jiang WL, Xu GM, Huang CG, Wang BG.. (2015) Bisthiodiketopiperazines and Acorane Sesquiterpenes Produced by the Marine-Derived Fungus Penicillium adametzioides AS-53 on Different Culture Media., 78 (6): [PMID:26039736 ] [10.1021/acs.jnatprod.5b00102 ]