Tricladic acid B

ID: ALA3581631

PubChem CID: 122178993

Max Phase: Preclinical

Molecular Formula: C13H20O5

Molecular Weight: 256.30

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=C(C(=O)O)/C(=C\CCCC[C@@H](O)CC)C(=O)O

Standard InChI:  InChI=1S/C13H20O5/c1-3-10(14)7-5-4-6-8-11(13(17)18)9(2)12(15)16/h8,10,14H,2-7H2,1H3,(H,15,16)(H,17,18)/b11-8+/t10-/m0/s1

Standard InChI Key:  NSVBQXZBZSCZMM-NGPGYTDTSA-N

Molfile:  

     RDKit          2D

 18 17  0  0  0  0  0  0  0  0999 V2000
    3.9031    2.2508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9000    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3000    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3000    1.9500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2606    0.1503    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8649    2.8526    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9431    2.8494    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6000   -1.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2014   -1.5008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5014   -2.2508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5028   -3.7516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8028   -4.5016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8042   -6.0025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1042   -6.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1054   -7.9525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7654   -6.6031    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  4  6  2  0
  1  7  1  0
  1  8  2  0
  3  9  2  0
  2 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 15 18  1  6
M  END

Alternative Forms

  1. Parent:

    ALA3581631

    ---

Associated Targets(non-human)

Phytophthora capsici (336 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 256.30Molecular Weight (Monoisotopic): 256.1311AlogP: 1.97#Rotatable Bonds: 9
Polar Surface Area: 94.83Molecular Species: ACIDHBA: 3HBD: 3
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 3.63CX Basic pKa: CX LogP: 2.17CX LogD: -4.10
Aromatic Rings: Heavy Atoms: 18QED Weighted: 0.33Np Likeness Score: 1.35

References

1. Han C, Furukawa H, Tomura T, Fudou R, Kaida K, Choi BK, Imokawa G, Ojika M..  (2015)  Bioactive Maleic Anhydrides and Related Diacids from the Aquatic Hyphomycete Tricladium castaneicola.,  78  (4): [PMID:25875311] [10.1021/np500773s]

Source