The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-2-cyano-3-(4-(diphenylamino)-2-methoxyphenyl)acrylate sodium ID: ALA3582423
PubChem CID: 122179536
Max Phase: Preclinical
Molecular Formula: C23H17N2NaO3
Molecular Weight: 370.41
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(N(c2ccccc2)c2ccccc2)ccc1/C=C(\C#N)C(=O)[O-].[Na+]
Standard InChI: InChI=1S/C23H18N2O3.Na/c1-28-22-15-21(13-12-17(22)14-18(16-24)23(26)27)25(19-8-4-2-5-9-19)20-10-6-3-7-11-20;/h2-15H,1H3,(H,26,27);/q;+1/p-1/b18-14+;
Standard InChI Key: OZWQMXABJHRPTE-LSJACRKWSA-M
Molfile:
RDKit 2D
29 30 0 0 0 0 0 0 0 0999 V2000
8.9970 1.1273 0.0000 Na 0 0 0 0 0 15 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0031 -3.0008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0432 -3.5993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6003 -1.4978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8990 -0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8978 0.7553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2011 -1.4918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2046 -2.6918 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.2389 -0.8892 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8969 1.9553 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5972 1.5031 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8915 3.7585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2934 3.7495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2883 5.2495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5847 6.0040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8863 5.2585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8982 0.7550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1971 1.5055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4964 0.7559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4970 -0.7441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1983 -1.4946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8989 -0.7450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
7 8 1 0
8 9 1 0
6 10 1 0
10 11 2 0
11 12 1 0
11 13 1 0
13 14 1 0
13 15 2 0
12 16 3 0
3 17 1 0
17 19 1 0
17 24 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
M CHG 2 1 1 14 -1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 370.41Molecular Weight (Monoisotopic): 370.1317AlogP: 5.16#Rotatable Bonds: 6Polar Surface Area: 73.56Molecular Species: ACIDHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 2.03CX Basic pKa: ┄CX LogP: 5.11CX LogD: 1.59Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.48Np Likeness Score: -0.58
References 1. Gurrapu S, Jonnalagadda SK, Alam MA, Nelson GL, Sneve MG, Drewes LR, Mereddy VR.. (2015) Monocarboxylate transporter 1 inhibitors as potential anticancer agents., 6 (5): [PMID:26005533 ] [10.1021/acsmedchemlett.5b00049 ]