The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-{4-[2-(2-Hydroxyethylamino)acetyl]piperazin-1-yl}-9-methoxy-11H-indeno[1,2-c]quinolin-11-one ID: ALA3585491
PubChem CID: 101885915
Max Phase: Preclinical
Molecular Formula: C25H26N4O4
Molecular Weight: 446.51
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc2c(c1)C(=O)c1c-2c(N2CCN(C(=O)CNCCO)CC2)nc2ccccc12
Standard InChI: InChI=1S/C25H26N4O4/c1-33-16-6-7-17-19(14-16)24(32)22-18-4-2-3-5-20(18)27-25(23(17)22)29-11-9-28(10-12-29)21(31)15-26-8-13-30/h2-7,14,26,30H,8-13,15H2,1H3
Standard InChI Key: XYZLSPRUAWQJRC-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
3.5632 -2.4942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5431 -1.4253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0754 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0934 -2.2270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5812 -0.7794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4942 0.2895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0934 1.7370 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.6236 2.0488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1433 3.4707 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3241 3.7793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7907 5.2049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7893 6.3217 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.6786 6.0130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1451 4.5874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0891 -0.4677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3340 0.9353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0690 -1.3585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2938 -0.4677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8484 0.9353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8728 2.0488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3426 1.7370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8103 0.2672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7636 -0.8240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2691 -0.0829 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.6106 -1.2332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0528 -2.5584 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2532 7.7491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4271 7.9981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2497 8.8651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7136 10.2924 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2899 11.4085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1740 12.8358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6284 13.7281 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 16 1 0
15 5 1 0
9 10 1 0
9 14 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
8 9 1 0
15 16 2 0
16 19 1 0
18 17 1 0
17 15 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
22 24 1 0
24 25 1 0
17 26 2 0
12 27 1 0
27 28 2 0
27 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 446.51Molecular Weight (Monoisotopic): 446.1954AlogP: 1.69#Rotatable Bonds: 6Polar Surface Area: 95.00Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.33CX LogP: 1.70CX LogD: 0.73Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.44Np Likeness Score: -0.55
References 1. Tseng C, Tzeng C, Chiu C, Yang C, Lu P, Chou C, Liu C, Chen Y. (2014) Synthesis and antiproliferative evaluation of 9-methoxy-6-(piperazin-1-yl)-11H-indeno[1,2-c]quinoline-11-one derivatives. Part 4, 5 (7): [10.1039/C4MD00133H ]