The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-{4-{2-[3-(Dimethylamino)propylamino]acetyl}piperazin-1-yl}-9-methoxy-11H-indeno[1,2-c]quinolin-11-one ID: ALA3585493
PubChem CID: 101885916
Max Phase: Preclinical
Molecular Formula: C28H33N5O3
Molecular Weight: 487.60
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc2c(c1)C(=O)c1c-2c(N2CCN(C(=O)CNCCCN(C)C)CC2)nc2ccccc12
Standard InChI: InChI=1S/C28H33N5O3/c1-31(2)12-6-11-29-18-24(34)32-13-15-33(16-14-32)28-26-20-10-9-19(36-3)17-22(20)27(35)25(26)21-7-4-5-8-23(21)30-28/h4-5,7-10,17,29H,6,11-16,18H2,1-3H3
Standard InChI Key: UIJLUHVCJFGILF-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
-0.5574 8.6295 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3399 7.7198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.0935 0.7965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0891 -0.4677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6236 2.0488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2938 -0.4677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1232 4.6057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0934 -2.2270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4942 0.2895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5632 -2.4942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8435 6.3034 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.2820 11.1108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8146 7.9990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7856 9.6945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0754 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3340 0.9353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6299 6.0223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5431 -1.4253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8237 5.1680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7636 -0.8240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8103 0.2672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3426 1.7370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3304 3.7514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2705 -0.0768 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.1433 3.4707 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0690 -1.3585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3110 9.4153 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0528 -2.5584 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.8728 2.0488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5812 -0.7794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8484 0.9353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0934 1.7370 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.7567 11.3900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.2531 12.8064 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-8.4322 13.0296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4706 13.7161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31 29 1 0
5 25 1 0
4 30 1 0
30 8 2 0
6 26 1 0
17 11 1 0
20 6 1 0
9 32 1 0
14 12 1 0
16 31 1 0
4 16 2 0
27 14 1 0
2 1 2 0
11 19 1 0
26 28 2 0
13 27 1 0
5 16 1 0
15 9 2 0
7 17 1 0
26 4 1 0
8 10 1 0
32 5 2 0
19 23 1 0
21 20 2 0
11 2 1 0
22 21 1 0
6 31 2 0
25 7 1 0
29 22 2 0
25 23 1 0
24 3 1 0
10 18 2 0
30 9 1 0
2 13 1 0
21 24 1 0
18 15 1 0
12 33 1 0
33 34 1 0
34 35 1 0
34 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 487.60Molecular Weight (Monoisotopic): 487.2583AlogP: 2.64#Rotatable Bonds: 8Polar Surface Area: 78.01Molecular Species: BASEHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.48CX LogP: 2.47CX LogD: 0.32Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.38Np Likeness Score: -0.78
References 1. Tseng C, Tzeng C, Chiu C, Yang C, Lu P, Chou C, Liu C, Chen Y. (2014) Synthesis and antiproliferative evaluation of 9-methoxy-6-(piperazin-1-yl)-11H-indeno[1,2-c]quinoline-11-one derivatives. Part 4, 5 (7): [10.1039/C4MD00133H ]