The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-{4-{3-[2-(Dimethylamino)ethylamino]propanoyl}piperazin-1-yl}-9-methoxy-11H-indeno[1,2-c]quinolin-11-one ID: ALA3585499
PubChem CID: 122179631
Max Phase: Preclinical
Molecular Formula: C27H31N5O3
Molecular Weight: 473.58
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CNCCNCCC(=O)N1CCN(c2nc3ccccc3c3c2-c2ccc(OC)cc2C3=O)CC1
Standard InChI: InChI=1S/C27H31N5O3/c1-28-11-12-29-10-9-23(33)31-13-15-32(16-14-31)27-25-19-8-7-18(35-2)17-21(19)26(34)24(25)20-5-3-4-6-22(20)30-27/h3-8,17,28-29H,9-16H2,1-2H3
Standard InChI Key: UMJHFSPEFHMBSS-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
3.5632 -2.4942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5431 -1.4253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0754 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0934 -2.2270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5812 -0.7794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4942 0.2895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0934 1.7370 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.6236 2.0488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1433 3.4707 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3241 3.7793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7907 5.2049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7893 6.3217 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.6786 6.0130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1451 4.5874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0891 -0.4677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3340 0.9353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0690 -1.3585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2938 -0.4677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8484 0.9353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8728 2.0488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3426 1.7370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8103 0.2672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7636 -0.8240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2691 -0.0829 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.6106 -1.2332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0528 -2.5584 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2532 7.7491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4271 7.9981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2497 8.8651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7136 10.2924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2899 11.4085 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.1740 12.8358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8295 13.9518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3657 15.3792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1680 16.2715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 16 1 0
15 5 1 0
9 10 1 0
9 14 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
8 9 1 0
15 16 2 0
16 19 1 0
18 17 1 0
17 15 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
22 24 1 0
24 25 1 0
17 26 2 0
12 27 1 0
27 28 2 0
27 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 473.58Molecular Weight (Monoisotopic): 473.2427AlogP: 2.30#Rotatable Bonds: 8Polar Surface Area: 86.80Molecular Species: BASEHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.64CX LogP: 2.26CX LogD: 0.02Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.38Np Likeness Score: -0.46
References 1. Tseng C, Tzeng C, Chiu C, Yang C, Lu P, Chou C, Liu C, Chen Y. (2014) Synthesis and antiproliferative evaluation of 9-methoxy-6-(piperazin-1-yl)-11H-indeno[1,2-c]quinoline-11-one derivatives. Part 4, 5 (7): [10.1039/C4MD00133H ]