The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-{4-[2-Hydroxy-3-(methylamino)propyl]piperazin-1-yl}-9-methoxy-11H-indeno [1,2-c]quinolin-11-one ID: ALA3585504
PubChem CID: 68766753
Max Phase: Preclinical
Molecular Formula: C25H28N4O3
Molecular Weight: 432.52
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CNCC(O)CN1CCN(c2nc3ccccc3c3c2-c2ccc(OC)cc2C3=O)CC1
Standard InChI: InChI=1S/C25H28N4O3/c1-26-14-16(30)15-28-9-11-29(12-10-28)25-23-18-8-7-17(32-2)13-20(18)24(31)22(23)19-5-3-4-6-21(19)27-25/h3-8,13,16,26,30H,9-12,14-15H2,1-2H3
Standard InChI Key: LFBTWBGFPKJTGS-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
3.5632 -2.4942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5431 -1.4253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0754 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0934 -2.2270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5812 -0.7794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4942 0.2895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0934 1.7370 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.6236 2.0488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1433 3.4707 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3241 3.7793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7907 5.2049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7893 6.3217 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.6786 6.0130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1451 4.5874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0891 -0.4677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3340 0.9353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0690 -1.3585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2938 -0.4677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8484 0.9353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8728 2.0488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3426 1.7370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8103 0.2672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7636 -0.8240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2691 -0.0829 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.6106 -1.2332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0528 -2.5584 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2532 7.7491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2497 8.8651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9242 8.6160 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7136 10.2924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2899 11.4085 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0810 12.5497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 16 1 0
15 5 1 0
9 10 1 0
9 14 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
8 9 1 0
15 16 2 0
16 19 1 0
18 17 1 0
17 15 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
22 24 1 0
24 25 1 0
17 26 2 0
12 27 1 0
27 28 1 0
28 29 1 0
28 30 1 0
30 31 1 0
31 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 432.52Molecular Weight (Monoisotopic): 432.2161AlogP: 2.16#Rotatable Bonds: 6Polar Surface Area: 77.93Molecular Species: BASEHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.55CX LogP: 2.66CX LogD: 0.54Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.48Np Likeness Score: -0.36
References 1. Tseng C, Tzeng C, Chiu C, Yang C, Lu P, Chou C, Liu C, Chen Y. (2014) Synthesis and antiproliferative evaluation of 9-methoxy-6-(piperazin-1-yl)-11H-indeno[1,2-c]quinoline-11-one derivatives. Part 4, 5 (7): [10.1039/C4MD00133H ]