The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-{4-[3-(Dimethylamino)-2-hydroxypropyl]piperazin-1-yl}-9-methoxy-11H-indeno [1,2-c]quinolin-11-on ID: ALA3585505
PubChem CID: 101885923
Max Phase: Preclinical
Molecular Formula: C26H30N4O3
Molecular Weight: 446.55
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc2c(c1)C(=O)c1c-2c(N2CCN(CC(O)CN(C)C)CC2)nc2ccccc12
Standard InChI: InChI=1S/C26H30N4O3/c1-28(2)15-17(31)16-29-10-12-30(13-11-29)26-24-19-9-8-18(33-3)14-21(19)25(32)23(24)20-6-4-5-7-22(20)27-26/h4-9,14,17,31H,10-13,15-16H2,1-3H3
Standard InChI Key: CGMHXEPQKJVKEP-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
3.5632 -2.4942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5431 -1.4253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0754 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0934 -2.2270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5812 -0.7794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4942 0.2895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0934 1.7370 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.6236 2.0488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1433 3.4707 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3241 3.7793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7907 5.2049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7893 6.3217 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.6786 6.0130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1451 4.5874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0891 -0.4677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3340 0.9353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0690 -1.3585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2938 -0.4677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8484 0.9353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8728 2.0488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3426 1.7370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8103 0.2672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7636 -0.8240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2691 -0.0829 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.6106 -1.2332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0528 -2.5584 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2532 7.7491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2497 8.8651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9242 8.6160 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7136 10.2924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2899 11.4085 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0810 12.5497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4638 11.1594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 16 1 0
15 5 1 0
9 10 1 0
9 14 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
8 9 1 0
15 16 2 0
16 19 1 0
18 17 1 0
17 15 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
22 24 1 0
24 25 1 0
17 26 2 0
12 27 1 0
27 28 1 0
28 29 1 0
28 30 1 0
30 31 1 0
31 32 1 0
31 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 446.55Molecular Weight (Monoisotopic): 446.2318AlogP: 2.50#Rotatable Bonds: 6Polar Surface Area: 69.14Molecular Species: BASEHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.83CX LogP: 3.04CX LogD: 1.60Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.49Np Likeness Score: -0.68
References 1. Tseng C, Tzeng C, Chiu C, Yang C, Lu P, Chou C, Liu C, Chen Y. (2014) Synthesis and antiproliferative evaluation of 9-methoxy-6-(piperazin-1-yl)-11H-indeno[1,2-c]quinoline-11-one derivatives. Part 4, 5 (7): [10.1039/C4MD00133H ]