The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-{4-[2-Hydroxy-3-(dimethylamino)propyl]piperazin-1-yl}-9-methoxy-11H-indeno [1,2-c]quinolin-11-one-[2-hydroxy-3-(dimethyl-amino)propyl]oxime ID: ALA3585507
PubChem CID: 122179635
Max Phase: Preclinical
Molecular Formula: C31H42N6O4
Molecular Weight: 562.72
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc2c(c1)/C(=N\OCC(O)CN(C)C)c1c-2c(N2CCN(CC(O)CN(C)C)CC2)nc2ccccc12
Standard InChI: InChI=1S/C31H42N6O4/c1-34(2)17-21(38)19-36-12-14-37(15-13-36)31-29-24-11-10-23(40-5)16-26(24)30(33-41-20-22(39)18-35(3)4)28(29)25-8-6-7-9-27(25)32-31/h6-11,16,21-22,38-39H,12-15,17-20H2,1-5H3/b33-30+
Standard InChI Key: IMGYEMUXTJCTPS-KKYHWDRJSA-N
Molfile:
RDKit 2D
41 45 0 0 0 0 0 0 0 0999 V2000
3.5632 -2.4942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5431 -1.4253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0754 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0934 -2.2270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5812 -0.7794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4942 0.2895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0934 1.7370 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.6236 2.0488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1433 3.4707 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3241 3.7793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7907 5.2049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7893 6.3217 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.6786 6.0130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1451 4.5874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0891 -0.4677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3340 0.9353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0690 -1.3585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2938 -0.4677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8484 0.9353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8728 2.0488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3426 1.7370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8103 0.2672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7636 -0.8240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2691 -0.0829 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.6106 -1.2332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0350 -2.8561 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2532 7.7491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3171 -3.6364 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.2834 -5.1368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2497 8.8651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7136 10.2924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9242 8.6160 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2899 11.4085 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0810 12.5497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4638 11.1594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5655 -5.9170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6181 -5.3408 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.5318 -7.4175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8139 -8.1977 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.7870 -9.3974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8665 -7.6215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 16 1 0
15 5 1 0
9 10 1 0
9 14 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
8 9 1 0
15 16 2 0
16 19 1 0
18 17 1 0
17 15 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
22 24 1 0
24 25 1 0
17 26 2 0
12 27 1 0
26 28 1 0
28 29 1 0
27 30 1 0
30 31 1 0
30 32 1 0
31 33 1 0
33 34 1 0
33 35 1 0
29 36 1 0
36 37 1 0
36 38 1 0
38 39 1 0
39 40 1 0
39 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 562.72Molecular Weight (Monoisotopic): 562.3268AlogP: 1.96#Rotatable Bonds: 11Polar Surface Area: 97.13Molecular Species: BASEHBA: 10HBD: 2#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.89CX Basic pKa: 9.18CX LogP: 2.82CX LogD: -0.17Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.27Np Likeness Score: -0.89
References 1. Tseng C, Tzeng C, Chiu C, Yang C, Lu P, Chou C, Liu C, Chen Y. (2014) Synthesis and antiproliferative evaluation of 9-methoxy-6-(piperazin-1-yl)-11H-indeno[1,2-c]quinoline-11-one derivatives. Part 4, 5 (7): [10.1039/C4MD00133H ]