The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(Z)-3-(3-Bromo-4-hydroxybenzoyl)-5-(3,5-dibromo-4-hydroxybenzylidene)-4-(3,5-dibromo-4-hydroxyphenyl)furan-2(5H)-one ID: ALA3585712
PubChem CID: 122179810
Max Phase: Preclinical
Molecular Formula: C24H11Br5O6
Molecular Weight: 794.87
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C1O/C(=C\c2cc(Br)c(O)c(Br)c2)C(c2cc(Br)c(O)c(Br)c2)=C1C(=O)c1ccc(O)c(Br)c1
Standard InChI: InChI=1S/C24H11Br5O6/c25-12-6-10(1-2-17(12)30)21(31)20-19(11-7-15(28)23(33)16(29)8-11)18(35-24(20)34)5-9-3-13(26)22(32)14(27)4-9/h1-8,30,32-33H/b18-5-
Standard InChI Key: QAKWYMBCCBBOOK-DVZOWYKESA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5972 1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3786 3.8595 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8371 5.2877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3371 5.2929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8056 3.8680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2318 3.4007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4202 4.3073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8040 3.7286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9947 2.2408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8016 1.3317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4177 1.9104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2161 6.5063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4096 6.3821 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1284 6.2561 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.1018 1.7778 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.3383 -1.3500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6046 7.8769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4828 9.0930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8689 10.4616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3767 10.6142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4984 9.3982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1123 8.0296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8855 11.7091 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -2.7000 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
6.9542 0.1414 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
0.3046 9.5203 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
-2.3383 1.3500 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
8.7585 4.4559 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 8 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
12 13 1 0
19 20 2 0
11 19 1 0
10 21 2 0
16 22 1 0
5 23 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
19 24 1 0
27 30 1 0
6 31 1 0
17 32 1 0
28 33 1 0
4 34 1 0
15 35 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 794.87Molecular Weight (Monoisotopic): 789.6472AlogP: 7.85#Rotatable Bonds: 4Polar Surface Area: 104.06Molecular Species: ACIDHBA: 6HBD: 3#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 5.64CX Basic pKa: ┄CX LogP: 8.15CX LogD: 4.52Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.14Np Likeness Score: 0.68
References 1. Boulangé A, Parraga J, Galán A, Cabedo N, Leleu S, Sanz MJ, Cortes D, Franck X.. (2015) Synthesis and antibacterial activities of cadiolides A, B and C and analogues., 23 (13): [PMID:25913865 ] [10.1016/j.bmc.2015.04.010 ]