The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(Z)-5-(3-bromo-4-hydroxybenzylidene)-4-(3-bromo-4-methoxyphenyl)-3-(furan-2-carbonyl)furan-2(5H)-one ID: ALA3585732
PubChem CID: 122179829
Max Phase: Preclinical
Molecular Formula: C23H14Br2O6
Molecular Weight: 546.17
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(C2=C(C(=O)c3ccco3)C(=O)O/C2=C\c2ccc(O)c(Br)c2)cc1Br
Standard InChI: InChI=1S/C23H14Br2O6/c1-29-17-7-5-13(11-15(17)25)20-19(10-12-4-6-16(26)14(24)9-12)31-23(28)21(20)22(27)18-3-2-8-30-18/h2-11,26H,1H3/b19-10-
Standard InChI Key: PUEVHTKWHBLBLL-GRSHGNNSSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
3.9511 -0.8815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9531 -1.9978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5987 -1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7343 -2.9815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2010 -3.2956 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2506 0.5865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6137 -3.9759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1277 1.5822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0972 -7.9127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1467 -1.8743 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2866 3.0610 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9143 -5.4464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3890 0.9663 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5211 -8.3844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7938 -6.4437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6799 1.2418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9105 3.6579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9175 2.5336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6416 -7.3872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 2.7000 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
0.2008 -8.7105 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
3.3382 -5.9182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7638 -9.5596 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6003 1.4977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.6387 0.8962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 1 2 0
4 3 1 0
5 2 1 0
6 1 1 0
7 3 1 0
8 4 2 0
9 6 1 0
10 7 1 0
11 10 2 0
12 20 1 0
13 2 2 0
14 9 1 0
15 8 1 0
16 7 2 0
17 6 2 0
18 11 1 0
19 25 1 0
20 15 2 0
21 9 2 0
22 14 1 0
23 21 1 0
24 16 1 0
25 28 2 0
26 11 1 0
27 12 1 0
28 15 1 0
29 19 1 0
30 18 1 0
5 4 1 0
22 23 2 0
18 24 2 0
12 19 2 0
30 31 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 546.17Molecular Weight (Monoisotopic): 543.9157AlogP: 5.75#Rotatable Bonds: 5Polar Surface Area: 85.97Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 7.51CX Basic pKa: ┄CX LogP: 5.35CX LogD: 5.11Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.25Np Likeness Score: 0.39
References 1. Boulangé A, Parraga J, Galán A, Cabedo N, Leleu S, Sanz MJ, Cortes D, Franck X.. (2015) Synthesis and antibacterial activities of cadiolides A, B and C and analogues., 23 (13): [PMID:25913865 ] [10.1016/j.bmc.2015.04.010 ]